![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[TXT]](/icons/text.gif) | Nintendo Wii_New Super Mario Bros. Wii.html | 2014-10-12 18:14 | 338K | |
![[TXT]](/icons/text.gif) | page178.html | 2014-10-12 17:57 | 92K | |
![[TXT]](/icons/text.gif) | page79.html | 2014-10-12 17:58 | 92K | |
![[TXT]](/icons/text.gif) | page143.html | 2014-10-12 17:57 | 92K | |
![[TXT]](/icons/text.gif) | page62.html | 2014-10-12 17:58 | 92K | |
![[TXT]](/icons/text.gif) | page21.html | 2014-10-12 17:58 | 92K | |
![[TXT]](/icons/text.gif) | page159.html | 2014-10-12 17:57 | 92K | |
![[TXT]](/icons/text.gif) | page105.html | 2014-10-12 17:57 | 92K | |
![[TXT]](/icons/text.gif) | page182.html | 2014-10-12 17:57 | 92K | |
![[TXT]](/icons/text.gif) | page27.html | 2014-10-12 17:58 | 92K | |
![[TXT]](/icons/text.gif) | page72.html | 2014-10-12 17:58 | 92K | |
![[TXT]](/icons/text.gif) | page83.html | 2014-10-12 17:58 | 92K | |
![[TXT]](/icons/text.gif) | page3.html | 2014-10-12 17:58 | 92K | |
![[TXT]](/icons/text.gif) | page5.html | 2014-10-12 17:58 | 92K | |
![[TXT]](/icons/text.gif) | page146.html | 2014-10-12 17:57 | 92K | |
![[TXT]](/icons/text.gif) | page75.html | 2014-10-12 17:58 | 92K | |
![[TXT]](/icons/text.gif) | page157.html | 2014-10-12 17:57 | 92K | |
![[TXT]](/icons/text.gif) | page133.html | 2014-10-12 17:57 | 92K | |
![[TXT]](/icons/text.gif) | page184.html | 2014-10-12 17:57 | 92K | |
![[TXT]](/icons/text.gif) | page18.html | 2014-10-12 17:57 | 92K | |
![[TXT]](/icons/text.gif) | page102.html | 2014-10-12 17:57 | 92K | |
![[TXT]](/icons/text.gif) | page147.html | 2014-10-12 17:57 | 92K | |
![[TXT]](/icons/text.gif) | page174.html | 2014-10-12 17:57 | 92K | |
![[TXT]](/icons/text.gif) | page80.html | 2014-10-12 17:58 | 92K | |
![[TXT]](/icons/text.gif) | page161.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page10.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page93.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page96.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page135.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page14.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page149.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page77.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page166.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page59.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page172.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page179.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page162.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page150.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page139.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page2.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page144.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page186.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page86.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page181.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page9.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page167.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page131.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page153.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page74.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page37.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page163.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page57.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page85.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page148.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page1.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page154.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page183.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page145.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page165.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page101.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page32.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page49.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page160.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page89.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page151.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page156.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page187.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page164.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page60.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page73.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page11.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page8.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page134.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page26.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page31.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page17.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page180.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page87.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page69.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page25.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page119.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page4.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page120.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page82.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page104.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page19.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page76.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page16.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page132.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page50.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page65.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page155.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page130.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page33.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page171.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page137.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page185.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page78.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page97.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page158.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page58.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page24.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page13.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page177.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page36.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page109.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page28.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page106.html | 2014-10-12 17:57 | 91K | |
![[TXT]](/icons/text.gif) | page88.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page61.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page6.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page71.html | 2014-10-12 17:58 | 91K | |
![[TXT]](/icons/text.gif) | page111.html | 2014-10-12 17:57 | 90K | |
![[TXT]](/icons/text.gif) | page176.html | 2014-10-12 17:57 | 90K | |
![[TXT]](/icons/text.gif) | page169.html | 2014-10-12 17:57 | 90K | |
![[TXT]](/icons/text.gif) | page63.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page91.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page90.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page67.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page7.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page170.html | 2014-10-12 17:57 | 90K | |
![[TXT]](/icons/text.gif) | page141.html | 2014-10-12 17:57 | 90K | |
![[TXT]](/icons/text.gif) | page34.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page42.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page35.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page81.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page23.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page68.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page175.html | 2014-10-12 17:57 | 90K | |
![[TXT]](/icons/text.gif) | page45.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page30.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page29.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page173.html | 2014-10-12 17:57 | 90K | |
![[TXT]](/icons/text.gif) | page118.html | 2014-10-12 17:57 | 90K | |
![[TXT]](/icons/text.gif) | page103.html | 2014-10-12 17:57 | 90K | |
![[TXT]](/icons/text.gif) | page64.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page94.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page140.html | 2014-10-12 17:57 | 90K | |
![[TXT]](/icons/text.gif) | page95.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page99.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page138.html | 2014-10-12 17:57 | 90K | |
![[TXT]](/icons/text.gif) | page56.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page168.html | 2014-10-12 17:57 | 90K | |
![[TXT]](/icons/text.gif) | page47.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page22.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page136.html | 2014-10-12 17:57 | 90K | |
![[TXT]](/icons/text.gif) | page128.html | 2014-10-12 17:57 | 90K | |
![[TXT]](/icons/text.gif) | page66.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page114.html | 2014-10-12 17:57 | 90K | |
![[TXT]](/icons/text.gif) | page55.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page107.html | 2014-10-12 17:57 | 90K | |
![[TXT]](/icons/text.gif) | page100.html | 2014-10-12 17:57 | 90K | |
![[TXT]](/icons/text.gif) | page116.html | 2014-10-12 17:57 | 90K | |
![[TXT]](/icons/text.gif) | page92.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page123.html | 2014-10-12 17:57 | 90K | |
![[TXT]](/icons/text.gif) | page53.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page84.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page44.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page40.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page117.html | 2014-10-12 17:57 | 90K | |
![[TXT]](/icons/text.gif) | page41.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page12.html | 2014-10-12 17:57 | 90K | |
![[TXT]](/icons/text.gif) | page15.html | 2014-10-12 17:57 | 90K | |
![[TXT]](/icons/text.gif) | page152.html | 2014-10-12 17:57 | 90K | |
![[TXT]](/icons/text.gif) | page20.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page98.html | 2014-10-12 17:58 | 90K | |
![[TXT]](/icons/text.gif) | page113.html | 2014-10-12 17:57 | 89K | |
![[TXT]](/icons/text.gif) | page125.html | 2014-10-12 17:57 | 89K | |
![[TXT]](/icons/text.gif) | page52.html | 2014-10-12 17:58 | 89K | |
![[TXT]](/icons/text.gif) | page38.html | 2014-10-12 17:58 | 89K | |
![[TXT]](/icons/text.gif) | page46.html | 2014-10-12 17:58 | 89K | |
![[TXT]](/icons/text.gif) | page110.html | 2014-10-12 17:57 | 89K | |
![[TXT]](/icons/text.gif) | page48.html | 2014-10-12 17:58 | 89K | |
![[TXT]](/icons/text.gif) | page108.html | 2014-10-12 17:57 | 89K | |
![[TXT]](/icons/text.gif) | page51.html | 2014-10-12 17:58 | 89K | |
![[TXT]](/icons/text.gif) | page122.html | 2014-10-12 17:57 | 89K | |
![[TXT]](/icons/text.gif) | page115.html | 2014-10-12 17:57 | 89K | |
![[TXT]](/icons/text.gif) | page127.html | 2014-10-12 17:57 | 89K | |
![[TXT]](/icons/text.gif) | page121.html | 2014-10-12 17:57 | 89K | |
![[TXT]](/icons/text.gif) | page43.html | 2014-10-12 17:58 | 89K | |
![[TXT]](/icons/text.gif) | page129.html | 2014-10-12 17:57 | 89K | |
![[TXT]](/icons/text.gif) | page112.html | 2014-10-12 17:57 | 89K | |
![[TXT]](/icons/text.gif) | page54.html | 2014-10-12 17:58 | 89K | |
![[TXT]](/icons/text.gif) | page39.html | 2014-10-12 17:58 | 89K | |
![[TXT]](/icons/text.gif) | page124.html | 2014-10-12 17:57 | 88K | |
![[TXT]](/icons/text.gif) | page126.html | 2014-10-12 17:57 | 87K | |
![[TXT]](/icons/text.gif) | page188.html | 2014-10-12 17:58 | 84K | |
![[TXT]](/icons/text.gif) | page70.html | 2014-10-12 17:58 | 83K | |
![[TXT]](/icons/text.gif) | page142.html | 2014-10-12 17:57 | 68K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tom Clancy's Splinter Cell Blacklist.html | 2014-10-12 18:24 | 54K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Marvel vs. Capcom 3 Fate of Two Worlds.html | 2014-10-12 18:05 | 54K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Final Fantasy XIII.html | 2014-10-12 18:19 | 53K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Injustice Gods Among Us.html | 2014-10-12 18:05 | 52K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Red Dead Redemption.html | 2014-10-12 18:07 | 52K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Punch-Out!!.html | 2014-10-12 18:14 | 52K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Legend of Zelda Skyward Sword.html | 2014-10-12 18:16 | 52K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Battlefield 3.html | 2014-10-12 18:17 | 51K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_NBA Jam.html | 2014-10-12 18:14 | 51K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Mini Desktop Racing.html | 2014-10-12 18:13 | 51K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Destiny.html | 2014-10-12 18:02 | 51K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Assassin's Creed III Liberation HD.html | 2014-10-12 18:17 | 51K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Gran Turismo 5.html | 2014-10-12 18:19 | 50K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tekken 6.html | 2014-10-12 18:24 | 50K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rayman Origins.html | 2014-10-12 18:14 | 50K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Legend of Zelda Twilight Princess.html | 2014-10-12 18:16 | 50K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Final Fantasy XIII-2.html | 2014-10-12 18:19 | 49K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Xenoblade Chronicles.html | 2014-10-12 18:17 | 49K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Gears of War 3.html | 2014-10-12 18:04 | 49K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Borderlands 2.html | 2014-10-12 18:00 | 49K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Monopoly.html | 2014-10-12 18:13 | 49K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Grand Theft Auto V.html | 2014-10-12 18:19 | 49K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Metroid Prime Trilogy.html | 2014-10-12 18:13 | 49K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Final Fantasy XIII.html | 2014-10-12 18:04 | 49K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Tom Clancy's Splinter Cell Double Agent.html | 2014-10-12 18:16 | 49K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Heavenly Sword.html | 2014-10-12 18:20 | 49K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Arc Rise Fantasia.html | 2014-10-12 18:11 | 49K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Final Fantasy Crystal Chronicles The Crystal Bearers.html | 2014-10-12 18:12 | 48K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Madden NFL 13.html | 2014-10-12 18:05 | 48K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Need for Speed Carbon.html | 2014-10-12 18:14 | 48K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Gears of War 2.html | 2014-10-12 18:04 | 48K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tom Clancy's Splinter Cell Double Agent.html | 2014-10-12 18:10 | 48K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Harvest Moon Animal Parade.html | 2014-10-12 18:13 | 48K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Goldeneye 007.html | 2014-10-12 18:12 | 48K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Castlevania Lords of Shadow.html | 2014-10-12 18:18 | 48K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Afro Samurai.html | 2014-10-12 17:59 | 48K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Okami.html | 2014-10-12 18:14 | 48K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Mortal Kombat.html | 2014-10-12 18:06 | 48K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Incredible Hulk.html | 2014-10-12 18:16 | 48K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Mario Kart Wii.html | 2014-10-12 18:13 | 48K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mirror's Edge.html | 2014-10-12 18:21 | 48K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tomb Raider (2013).html | 2014-10-12 18:24 | 48K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Tatsunoko vs. Capcom Ultimate All-Stars.html | 2014-10-12 18:15 | 48K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Left 4 Dead 2.html | 2014-10-12 18:05 | 47K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_God of War III.html | 2014-10-12 18:19 | 47K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Last of Us.html | 2014-10-12 18:24 | 47K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Assassin's Creed.html | 2014-10-12 18:17 | 47K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Batman Arkham City.html | 2014-10-12 18:17 | 47K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rayman Raving Rabbids TV Party.html | 2014-10-12 18:14 | 47K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Battlefield Bad Company.html | 2014-10-12 17:59 | 47K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Battlefield Bad Company.html | 2014-10-12 18:17 | 47K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Grand Theft Auto V.html | 2014-10-12 18:04 | 47K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Enslaved Odyssey to the West.html | 2014-10-12 18:04 | 47K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Need for Speed Rivals.html | 2014-10-12 18:21 | 47K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Red Dead Redemption.html | 2014-10-12 18:22 | 47K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sonic Generations.html | 2014-10-12 18:08 | 47K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Muramasa The Demon Blade.html | 2014-10-12 18:14 | 47K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Red Faction Guerrilla.html | 2014-10-12 18:07 | 47K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Prince of Persia The Forgotten Sands.html | 2014-10-12 18:14 | 47K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Batman Arkham Asylum.html | 2014-10-12 18:17 | 47K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Bayonetta.html | 2014-10-12 18:17 | 47K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Battlefield 4.html | 2014-10-12 18:17 | 47K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Uncharted Drake's Fortune.html | 2014-10-12 18:24 | 47K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Bayonetta.html | 2014-10-12 17:59 | 47K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Mario Strikers Charged.html | 2014-10-12 18:13 | 47K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Elder Scrolls V Skyrim.html | 2014-10-12 18:09 | 47K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Halo 4.html | 2014-10-12 18:04 | 47K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Battle Fantasia.html | 2014-10-12 17:59 | 47K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Michael Jackson The Experience.html | 2014-10-12 18:13 | 47K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Madden NFL 07.html | 2014-10-12 18:13 | 47K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dragon Age Inquisition.html | 2014-10-12 18:03 | 47K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Call of Duty Ghosts.html | 2014-10-12 18:18 | 47K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Donkey Kong Country Returns.html | 2014-10-12 18:12 | 47K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Super Mario Galaxy.html | 2014-10-12 18:15 | 47K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Impossible Mission.html | 2014-10-12 18:13 | 47K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tom Clancy's Splinter Cell Conviction.html | 2014-10-12 18:10 | 47K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Super Mario Galaxy 2.html | 2014-10-12 18:15 | 47K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Mario & Sonic at the London 2012 Olympic Games.html | 2014-10-12 18:13 | 47K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tony Hawk's Pro Skater HD.html | 2014-10-12 18:24 | 46K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Killzone 2.html | 2014-10-12 18:20 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Red Steel 2.html | 2014-10-12 18:14 | 46K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Prince of Persia.html | 2014-10-12 18:07 | 46K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_WWE All Stars.html | 2014-10-12 18:10 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_TMNT.html | 2014-10-12 18:16 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Marvel Ultimate Alliance 2.html | 2014-10-12 18:13 | 46K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Borderlands.html | 2014-10-12 18:18 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Madden NFL 08.html | 2014-10-12 18:13 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cars.html | 2014-10-12 18:11 | 46K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Halo 3 ODST.html | 2014-10-12 18:04 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Disney Epic Mickey.html | 2014-10-12 18:12 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Kirby's Epic Yarn.html | 2014-10-12 18:13 | 46K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tom Clancy's Splinter Cell Double Agent.html | 2014-10-12 18:24 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Colin McRae DiRT 2.html | 2014-10-12 18:11 | 46K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mortal Kombat vs. DC Universe.html | 2014-10-12 18:21 | 46K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Madden NFL 07.html | 2014-10-12 18:05 | 46K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Assassin's Creed Brotherhood.html | 2014-10-12 17:59 | 46K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_007 Quantum of Solace.html | 2014-10-12 17:59 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Mini Ninjas.html | 2014-10-12 18:13 | 46K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_BioShock.html | 2014-10-12 17:59 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Harry Potter and the Order of the Phoenix.html | 2014-10-12 18:13 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Fragile Dreams Farewell Ruins of the Moon.html | 2014-10-12 18:12 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_LEGO Harry Potter Years 1-4.html | 2014-10-12 18:13 | 46K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Call of Duty Modern Warfare 2.html | 2014-10-12 18:18 | 46K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dragon Age Inquisition.html | 2014-10-12 18:18 | 46K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Madden NFL 08.html | 2014-10-12 18:05 | 46K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Assassin's Creed Revelations.html | 2014-10-12 17:59 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Last Story.html | 2014-10-12 18:16 | 46K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Halo Reach.html | 2014-10-12 18:04 | 46K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Assassin's Creed Revelations - Collectors Edition.html | 2014-10-12 17:59 | 46K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Metal Gear Solid 4 Guns of the Patriots.html | 2014-10-12 18:21 | 46K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hitman Absolution - Professional Edition.html | 2014-10-12 18:20 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Guitar Hero World Tour.html | 2014-10-12 18:13 | 46K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Mass Effect.html | 2014-10-12 18:06 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dragon Quest Swords The Masked Queen and the Tower of Mirrors.html | 2014-10-12 18:12 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_LEGO Star Wars The Complete Saga.html | 2014-10-12 18:13 | 46K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NBA Jam.html | 2014-10-12 18:06 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Alien Syndrome.html | 2014-10-12 18:11 | 46K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Devil May Cry 4.html | 2014-10-12 18:18 | 46K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Shadowrun.html | 2014-10-12 18:08 | 46K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tom Clancy's Splinter Cell Blacklist.html | 2014-10-12 18:10 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Marvel Ultimate Alliance.html | 2014-10-12 18:13 | 46K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mass Effect 2.html | 2014-10-12 18:21 | 46K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Metal Gear Rising Revengeance.html | 2014-10-12 18:21 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Transformers The Game.html | 2014-10-12 18:16 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rayman Raving Rabbids.html | 2014-10-12 18:14 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Avatar The Last Airbender.html | 2014-10-12 18:11 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_FIFA Soccer 09.html | 2014-10-12 18:12 | 46K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Lego Star Wars II The Original Trilogy.html | 2014-10-12 18:05 | 46K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Call of Duty Black Ops.html | 2014-10-12 18:18 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Sin & Punishment Star Successor.html | 2014-10-12 18:15 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Monster Hunter Tri.html | 2014-10-12 18:14 | 46K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_LittleBigPlanet.html | 2014-10-12 18:20 | 46K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Viva Piñata Trouble in Paradise.html | 2014-10-12 18:10 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_LEGO Indiana Jones 2 The Adventure Continues.html | 2014-10-12 18:13 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Sakura Wars So Long My Love.html | 2014-10-12 18:15 | 46K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Assassin's Creed.html | 2014-10-12 17:59 | 46K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Grand Theft Auto IV.html | 2014-10-12 18:19 | 46K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ratchet & Clank Future Tools of Destruction.html | 2014-10-12 18:22 | 46K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_MotorStorm Pacific Rift.html | 2014-10-12 18:21 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Trauma Team.html | 2014-10-12 18:16 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Super Smash Bros. Brawl.html | 2014-10-12 18:15 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rayman Raving Rabbids 2.html | 2014-10-12 18:14 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Mario & Sonic at the Olympic Winter Games.html | 2014-10-12 18:13 | 46K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rayman Origins.html | 2014-10-12 18:07 | 46K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_BioShock.html | 2014-10-12 18:17 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Monsters vs. Aliens.html | 2014-10-12 18:14 | 46K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Halo 4 Limited Edition.html | 2014-10-12 18:04 | 46K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Assassin's Creed IV Black Flag.html | 2014-10-12 17:59 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Price is Right 2010 Edition.html | 2014-10-12 18:16 | 46K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Diablo III.html | 2014-10-12 18:03 | 46K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Diablo III.html | 2014-10-12 18:18 | 46K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_LEGO Pirates of the Caribbean The Video Game.html | 2014-10-12 18:20 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Need for Speed ProStreet.html | 2014-10-12 18:14 | 46K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Driver San Francisco.html | 2014-10-12 18:03 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Lego Indiana Jones The Original Adventures.html | 2014-10-12 18:13 | 46K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Pirates of the Caribbean At World's End.html | 2014-10-12 18:14 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Alan Wake.html | 2014-10-12 17:59 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Grand Theft Auto IV.html | 2014-10-12 18:04 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Infamous.html | 2014-10-12 18:20 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_007 Quantum of Solace.html | 2014-10-12 18:17 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Uncharted 2 Among Thieves.html | 2014-10-12 18:24 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Tomb Raider Underworld.html | 2014-10-12 18:16 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cabela's Survival Shadows of Katmai.html | 2014-10-12 18:11 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Battalion Wars 2.html | 2014-10-12 18:11 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Toy Story 3.html | 2014-10-12 18:16 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Saboteur.html | 2014-10-12 18:24 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Assassin's Creed Anthology.html | 2014-10-12 17:59 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Guitar Hero III Legends of Rock.html | 2014-10-12 18:20 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Star Wars The Force Unleashed.html | 2014-10-12 18:15 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_No More Heroes.html | 2014-10-12 18:14 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tony Hawk's American Wasteland.html | 2014-10-12 18:10 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Marvel vs. Capcom 2 New Age of Heroes.html | 2014-10-12 18:21 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Halo Wars.html | 2014-10-12 18:04 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Resident Evil 5 Gold Edition.html | 2014-10-12 18:22 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dead Space Extraction.html | 2014-10-12 18:12 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Red Dead Redemption Undead Nightmare.html | 2014-10-12 18:07 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Watch Dogs.html | 2014-10-12 18:25 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Diablo III Reaper of Souls Ultimate Evil Edition.html | 2014-10-12 18:18 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Super Paper Mario.html | 2014-10-12 18:15 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Diablo III Reaper of Souls Ultimate Evil Edition.html | 2014-10-12 18:03 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Watch Dogs.html | 2014-10-12 18:10 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Mortal Kombat Armageddon.html | 2014-10-12 18:14 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Guardians of Middle-Earth.html | 2014-10-12 18:04 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Need for Speed Undercover.html | 2014-10-12 18:14 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Street Fighter IV.html | 2014-10-12 18:24 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Alpha Protocol.html | 2014-10-12 18:17 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Pandora's Tower.html | 2014-10-12 18:14 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Killzone 3.html | 2014-10-12 18:20 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Marvel Ultimate Alliance 2.html | 2014-10-12 18:05 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Valiant Hearts The Great War.html | 2014-10-12 18:24 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Bioshock 2.html | 2014-10-12 17:59 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Pro Evolution Soccer 2008.html | 2014-10-12 18:14 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Need for Speed Carbon.html | 2014-10-12 18:21 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Generator Rex Agent of Providence.html | 2014-10-12 18:12 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sonic Generations.html | 2014-10-12 18:23 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rock Band 2.html | 2014-10-12 18:14 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Happy Feet.html | 2014-10-12 18:13 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rock Band 2.html | 2014-10-12 18:07 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Avatar The Last Airbender – The Burning Earth.html | 2014-10-12 18:11 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Guitar Hero III Legends of Rock.html | 2014-10-12 18:13 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_FIFA 14.html | 2014-10-12 18:04 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Jet Set Radio HD.html | 2014-10-12 18:05 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Uncharted 3 Drake's Deception.html | 2014-10-12 18:24 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Alone in the Dark.html | 2014-10-12 18:11 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Metroid Other M.html | 2014-10-12 18:13 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Indiana Jones and the Staff of Kings.html | 2014-10-12 18:13 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Pro Evolution Soccer 2010.html | 2014-10-12 18:14 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Call of Duty 3.html | 2014-10-12 18:11 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dragon Age II.html | 2014-10-12 18:03 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Wii Sports Resort.html | 2014-10-12 18:17 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Alone in the Dark.html | 2014-10-12 17:59 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Harry Potter and the Half-Blood Prince.html | 2014-10-12 18:13 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Star Wars The Force Unleashed II.html | 2014-10-12 18:09 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Fire Emblem Radiant Dawn.html | 2014-10-12 18:12 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Destiny.html | 2014-10-12 18:18 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Transformers Revenge of the Fallen.html | 2014-10-12 18:16 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Guitar Hero III Legends of Rock.html | 2014-10-12 18:04 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Batman Arkham City.html | 2014-10-12 17:59 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tom Clancy's Ghost Recon Future Soldier.html | 2014-10-12 18:10 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Star Wars The Clone Wars – Republic Heroes.html | 2014-10-12 18:15 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Spider-Man 3.html | 2014-10-12 18:15 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Spider-Man Web of Shadows.html | 2014-10-12 18:15 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dragon Age II.html | 2014-10-12 18:18 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Raving Rabbids Travel in Time.html | 2014-10-12 18:14 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Lego Batman The Videogame.html | 2014-10-12 18:13 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ghostbusters The Video Game.html | 2014-10-12 18:12 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Halo 3.html | 2014-10-12 18:04 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_WWE '12.html | 2014-10-12 18:10 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Guitar Hero Aerosmith.html | 2014-10-12 18:13 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Monopoly.html | 2014-10-12 18:21 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dark Sector.html | 2014-10-12 18:02 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Spider-Man Shattered Dimensions.html | 2014-10-12 18:15 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ace Combat 6 Fires of Liberation.html | 2014-10-12 17:59 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Monopoly.html | 2014-10-12 18:06 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mercenaries 2 World in Flames.html | 2014-10-12 18:21 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Mercenaries 2 World in Flames.html | 2014-10-12 18:06 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mortal Kombat.html | 2014-10-12 18:21 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Metal Gear Solid HD Collection.html | 2014-10-12 18:21 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cabela's Adventure Camp.html | 2014-10-12 18:11 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Captain America Super Soldier.html | 2014-10-12 18:11 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Pinball Hall of Fame The Williams Collection.html | 2014-10-12 18:07 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Shrek the Third.html | 2014-10-12 18:15 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Simpsons Game.html | 2014-10-12 18:16 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Castlevania Judgment.html | 2014-10-12 18:11 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tom Clancy's Rainbow Six Vegas 2.html | 2014-10-12 18:24 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_House of the Dead Overkill Extended Cut.html | 2014-10-12 18:20 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Cloudy With a Chance of Meatballs.html | 2014-10-12 18:01 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Metal Gear Solid V The Phantom Pain.html | 2014-10-12 18:21 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Peppa Pig The Game.html | 2014-10-12 18:14 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Beatles Rock Band.html | 2014-10-12 18:15 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_New Play Control! Donkey Kong Jungle Beat.html | 2014-10-12 18:14 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Zumba Fitness.html | 2014-10-12 18:17 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_SimAnimals.html | 2014-10-12 18:15 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Mass Effect 2.html | 2014-10-12 18:05 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Trauma Center New Blood.html | 2014-10-12 18:16 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Iron Man 2.html | 2014-10-12 18:13 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Angry Birds Star Wars.html | 2014-10-12 17:59 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Fantastic Four Rise of the Silver Surfer.html | 2014-10-12 18:12 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Homefront.html | 2014-10-12 18:05 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Trivial Pursuit.html | 2014-10-12 18:16 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Lord of the Rings Aragorn's Quest.html | 2014-10-12 18:16 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sonic the Hedgehog.html | 2014-10-12 18:08 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Crash of the Titans.html | 2014-10-12 18:01 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Star Wars The Force Unleashed II.html | 2014-10-12 18:24 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Tales of Symphonia Dawn of the New World.html | 2014-10-12 18:15 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tomb Raider (2013).html | 2014-10-12 18:10 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_X-Men Origins Wolverine.html | 2014-10-12 18:17 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Battlefield 3.html | 2014-10-12 17:59 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_LEGO Pirates of the Caribbean The Video Game.html | 2014-10-12 18:13 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Bigs.html | 2014-10-12 18:15 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Final Fantasy XIII-2.html | 2014-10-12 18:04 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_007 Quantum of Solace.html | 2014-10-12 18:11 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_FIFA 15.html | 2014-10-12 18:04 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Spider-Man Friend or Foe.html | 2014-10-12 18:15 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Wii Fit.html | 2014-10-12 18:16 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Resident Evil Operation Raccoon City.html | 2014-10-12 18:07 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Kirby's Return To Dream Land.html | 2014-10-12 18:13 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ratatouille.html | 2014-10-12 18:14 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Tomb Raider Anniversary.html | 2014-10-12 18:16 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_2010 FIFA World Cup South Africa.html | 2014-10-12 18:11 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mass Effect.html | 2014-10-12 18:21 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Naruto Shippuden Ultimate Ninja Storm 3.html | 2014-10-12 18:06 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Meet the Robinsons.html | 2014-10-12 18:13 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Asura's Wrath.html | 2014-10-12 17:59 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Conduit.html | 2014-10-12 18:15 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Sonic Unleashed.html | 2014-10-12 18:15 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Need for Speed Carbon.html | 2014-10-12 18:06 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_G.I. Joe The Rise of Cobra.html | 2014-10-12 18:12 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Anubis II.html | 2014-10-12 18:11 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Batman Arkham Asylum.html | 2014-10-12 17:59 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_BioShock Infinite.html | 2014-10-12 17:59 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Assassin's Creed II.html | 2014-10-12 17:59 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rapala Pro Bass Fishing.html | 2014-10-12 18:07 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Amazing Spider-Man.html | 2014-10-12 18:09 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_de Blob 2.html | 2014-10-12 18:12 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_FIFA 15.html | 2014-10-12 18:19 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Battlefield 4.html | 2014-10-12 17:59 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_WWE SmackDown vs. Raw 2008.html | 2014-10-12 18:25 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Bully Scholarship Edition.html | 2014-10-12 18:11 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Carnival Games.html | 2014-10-12 18:11 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_WWE SmackDown vs. Raw 2008.html | 2014-10-12 18:17 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Soul Calibur V.html | 2014-10-12 18:08 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Darksiders.html | 2014-10-12 18:02 | 45K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Darksiders.html | 2014-10-12 18:18 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Pirates of the Caribbean At World's End.html | 2014-10-12 18:07 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Disney Princess Enchanted Journey.html | 2014-10-12 18:12 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Open Season.html | 2014-10-12 18:14 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Need for Speed Nitro.html | 2014-10-12 18:14 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_SpongeBob SquarePants Creature from the Krusty Krab.html | 2014-10-12 18:15 | 45K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Resident Evil 4 Wii Edition.html | 2014-10-12 18:14 | 45K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Call of Duty 3.html | 2014-10-12 18:00 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Titanfall.html | 2014-10-12 18:10 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Assassin's Creed Revelations.html | 2014-10-12 18:17 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Assassin's Creed III.html | 2014-10-12 18:17 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Major League Baseball 2K9.html | 2014-10-12 18:05 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Battlefield 2 Modern Combat.html | 2014-10-12 17:59 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Legend of Spyro The Eternal Night.html | 2014-10-12 18:16 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_WWE SmackDown vs. Raw 2008.html | 2014-10-12 18:10 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Sam & Max Beyond Time and Space.html | 2014-10-12 18:15 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_FIFA Soccer 08.html | 2014-10-12 18:12 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Metal Slug Anthology.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Final Fantasy X X-2 HD Remaster.html | 2014-10-12 18:19 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_WarioWare Smooth Moves.html | 2014-10-12 18:16 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_LEGO Star Wars The Complete Saga.html | 2014-10-12 18:20 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Blazing Angels Squadrons of WWII.html | 2014-10-12 18:11 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_007 Legends.html | 2014-10-12 18:17 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Middle-Earth Shadow of Mordor.html | 2014-10-12 18:21 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Middle-Earth Shadow of Mordor.html | 2014-10-12 18:06 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Bolt.html | 2014-10-12 18:11 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Call of Duty 4 Modern Warfare.html | 2014-10-12 18:00 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Haunted House.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Metal Gear Solid HD Collection.html | 2014-10-12 18:06 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The House of the Dead Overkill.html | 2014-10-12 18:16 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Madden NFL 06.html | 2014-10-12 18:05 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The ICO and Shadow of the Colossus Collection.html | 2014-10-12 18:24 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Wii Party.html | 2014-10-12 18:17 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Fallout 3.html | 2014-10-12 18:19 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Max Payne 3.html | 2014-10-12 18:21 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Lego Batman The Videogame.html | 2014-10-12 18:20 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Max Payne 3.html | 2014-10-12 18:06 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Brütal Legend.html | 2014-10-12 18:18 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Mario Power Tennis.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Splatterhouse.html | 2014-10-12 18:09 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Wario Land Shake It!.html | 2014-10-12 18:16 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Lego Batman The Videogame.html | 2014-10-12 18:05 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Mario Super Sluggers.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rayman Legends.html | 2014-10-12 18:07 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Harry Potter and the Deathly Hallows Part 2.html | 2014-10-12 18:05 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rabbids Go Home.html | 2014-10-12 18:14 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Heatseeker.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Lemmings.html | 2014-10-12 18:20 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_MySims.html | 2014-10-12 18:14 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Bakugan Battle Brawlers.html | 2014-10-12 17:59 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Strider.html | 2014-10-12 18:24 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Strider.html | 2014-10-12 18:09 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Demon's Souls.html | 2014-10-12 18:18 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Golden Axe Beast Rider.html | 2014-10-12 18:04 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Little Big Planet Game Of The Year, Greatest Hits.html | 2014-10-12 18:20 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Surf's Up.html | 2014-10-12 18:15 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tony Hawk's Proving Ground.html | 2014-10-12 18:10 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Air Conflicts Secret Wars.html | 2014-10-12 17:59 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Tiger Woods PGA Tour 08.html | 2014-10-12 18:16 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tom Clancy's Rainbow Six Vegas.html | 2014-10-12 18:10 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Forza Motorsport 3.html | 2014-10-12 18:04 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Call of Duty Ghosts.html | 2014-10-12 18:00 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_LEGO Harry Potter Years 5-7.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Star Wars The Force Unleashed II Collector's Edition.html | 2014-10-12 18:24 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Jeopardy!.html | 2014-10-12 18:20 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Wii Sports.html | 2014-10-12 18:17 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_New Play Control! Pikmin.html | 2014-10-12 18:14 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fable III.html | 2014-10-12 18:04 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Cabela's Big Game Hunter 2012.html | 2014-10-12 18:00 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dying Light.html | 2014-10-12 18:03 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Gears of War.html | 2014-10-12 18:04 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Godfather Blackhand Edition.html | 2014-10-12 18:15 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Active Life Outdoor Challenge.html | 2014-10-12 18:11 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Zumba Fitness.html | 2014-10-12 18:10 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Barnyard.html | 2014-10-12 18:11 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fantastic Four Rise of the Silver Surfer.html | 2014-10-12 18:04 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Karaoke Revolution Presents American Idol Encore.html | 2014-10-12 18:05 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Scarface The World Is Yours.html | 2014-10-12 18:15 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Virtua Tennis 4.html | 2014-10-12 18:16 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Ant Bully.html | 2014-10-12 18:15 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Call of Duty Modern Warfare 3.html | 2014-10-12 18:00 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ghostbusters The Video Game.html | 2014-10-12 18:04 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Resistance Fall of Man.html | 2014-10-12 18:22 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Grand Slam Tennis.html | 2014-10-12 18:12 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Spider-Man Web of Shadows.html | 2014-10-12 18:09 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_MX vs. ATV Untamed.html | 2014-10-12 18:06 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Metal Gear Solid V The Phantom Pain.html | 2014-10-12 18:06 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Lego Rock Band.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Resident Evil The Darkside Chronicles.html | 2014-10-12 18:14 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Shaun White Snowboarding Road Trip.html | 2014-10-12 18:15 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Zack & Wiki Quest for Barbaros' Treasure.html | 2014-10-12 18:17 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rune Factory Tides of Destiny.html | 2014-10-12 18:15 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Pro Evolution Soccer 2012.html | 2014-10-12 18:07 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Lego Indiana Jones The Original Adventures.html | 2014-10-12 18:20 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Wii Fit Plus.html | 2014-10-12 18:16 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Manhunt 2.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_MySims Party.html | 2014-10-12 18:14 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_WWE '13.html | 2014-10-12 18:17 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Mass Effect 3 - N7 Collector's Edition.html | 2014-10-12 18:05 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Fallout 3 Game of the Year Edition.html | 2014-10-12 18:19 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Gun.html | 2014-10-12 18:04 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Call of Duty 3.html | 2014-10-12 18:18 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Damnation.html | 2014-10-12 18:01 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dynasty Warriors 7 Xtreme Legends.html | 2014-10-12 18:19 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Disney Universe.html | 2014-10-12 18:12 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Driver Parallel Lines.html | 2014-10-12 18:12 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Far Cry Vengeance.html | 2014-10-12 18:12 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ratchet & Clank Future A Crack in Time.html | 2014-10-12 18:22 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fallout New Vegas Ultimate Edition.html | 2014-10-12 18:04 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dead to Rights Retribution.html | 2014-10-12 18:18 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Harvest Moon Magical Melody.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Madden NFL 11.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_DC Universe Online.html | 2014-10-12 18:18 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fight Night Round 3.html | 2014-10-12 18:04 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Conflict Denied Ops.html | 2014-10-12 18:01 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_MadWorld.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rage Anarchy Edition.html | 2014-10-12 18:22 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Borderlands 2.html | 2014-10-12 18:17 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fallout 3 Game of the Year Edition.html | 2014-10-12 18:04 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Amazing Spider-Man.html | 2014-10-12 18:15 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Portal 2.html | 2014-10-12 18:22 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Sega Superstars Tennis.html | 2014-10-12 18:15 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_WALL-E.html | 2014-10-12 18:16 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Major League Baseball 2K7.html | 2014-10-12 18:05 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Fatal Frame IV Mask of the Lunar Eclipse.html | 2014-10-12 18:12 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dragon Ball Z Budokai Tenkaichi 3.html | 2014-10-12 18:12 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Medal of Honor Vanguard.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_F1 2010.html | 2014-10-12 18:04 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NeverDead.html | 2014-10-12 18:06 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Blazing Angels Squadrons of WWII.html | 2014-10-12 18:17 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Blazing Angels Squadrons of WWII.html | 2014-10-12 17:59 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Boom Blox Bash Party.html | 2014-10-12 18:11 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ashes Cricket 2009.html | 2014-10-12 18:11 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Frogger.html | 2014-10-12 18:04 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Spider-Man Shattered Dimensions.html | 2014-10-12 18:09 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Valkyria Chronicles.html | 2014-10-12 18:24 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Call of Duty Black Ops II.html | 2014-10-12 18:18 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Plants vs. Zombies Garden Warfare.html | 2014-10-12 18:22 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Spider-Man Shattered Dimensions.html | 2014-10-12 18:23 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_F.E.A.R..html | 2014-10-12 18:19 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Hasbro Family Game Night 2.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Wolfenstein.html | 2014-10-12 18:10 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sega Superstars Tennis.html | 2014-10-12 18:08 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Metroid Prime 3 Corruption.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Aliens vs. Predator.html | 2014-10-12 18:17 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_F.E.A.R..html | 2014-10-12 18:04 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rayman Legends.html | 2014-10-12 18:22 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tony Hawk's Project 8.html | 2014-10-12 18:24 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Samba de Amigo.html | 2014-10-12 18:15 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Call of Duty Modern Warfare 3.html | 2014-10-12 18:18 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Create.html | 2014-10-12 18:12 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Trauma Center Second Opinion.html | 2014-10-12 18:16 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_WWE SmackDown vs. Raw 2010.html | 2014-10-12 18:17 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Sims 2 Castaway.html | 2014-10-12 18:16 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Test Drive Unlimited.html | 2014-10-12 18:09 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_F.E.A.R. 2 Project Origin.html | 2014-10-12 18:04 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Monsters vs. Aliens.html | 2014-10-12 18:06 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_LEGO Batman 2 DC Super Heroes.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Marvel Ultimate Alliance.html | 2014-10-12 18:05 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Kingdoms of Amalur Reckoning.html | 2014-10-12 18:05 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Borderlands.html | 2014-10-12 18:00 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_de Blob.html | 2014-10-12 18:12 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Star Trek.html | 2014-10-12 18:23 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Call of Duty World at War.html | 2014-10-12 18:11 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Star Wars The Force Unleashed.html | 2014-10-12 18:09 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Skylanders Trap Team.html | 2014-10-12 18:15 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Harvey Birdman Attorney at Law.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tom Clancy's Rainbow Six Vegas 2.html | 2014-10-12 18:10 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tiger Woods PGA Tour 07.html | 2014-10-12 18:10 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Need for Speed Rivals.html | 2014-10-12 18:06 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_A Boy and His Blob.html | 2014-10-12 18:11 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Cartoon Network Punch Time Explosion XL.html | 2014-10-12 18:18 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_We Sing Down Under.html | 2014-10-12 18:16 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_South Park The Stick of Truth.html | 2014-10-12 18:23 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Elder Scrolls V Skyrim.html | 2014-10-12 18:24 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Monsters vs. Aliens.html | 2014-10-12 18:21 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Skylanders Trap Team.html | 2014-10-12 18:08 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Shrek the Third.html | 2014-10-12 18:08 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Resident Evil Archives Resident Evil.html | 2014-10-12 18:14 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Elder Scrolls IV Oblivion.html | 2014-10-12 18:24 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Spider-Man 3.html | 2014-10-12 18:23 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Skylanders Trap Team.html | 2014-10-12 18:23 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dynasty Warriors 6 Empires.html | 2014-10-12 18:03 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Sega Bass Fishing.html | 2014-10-12 18:15 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sid Meier's Civilization Revolution.html | 2014-10-12 18:08 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dante's Inferno.html | 2014-10-12 18:02 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Katamari Forever.html | 2014-10-12 18:20 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_FIFA 14.html | 2014-10-12 18:19 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ni no Kuni Wrath of the White Witch.html | 2014-10-12 18:21 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Madden NFL 09.html | 2014-10-12 18:20 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Crash of the Titans.html | 2014-10-12 18:12 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Animal Crossing City Folk.html | 2014-10-12 18:11 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Marvel Super Hero Squad.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Call of Duty Modern Warfare - Reflex Edition.html | 2014-10-12 18:11 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Army of Two.html | 2014-10-12 17:59 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Harvest Moon Tree of Tranquility.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NBA 08.html | 2014-10-12 18:21 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Star Wars The Force Unleashed II.html | 2014-10-12 18:15 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Prototype 2.html | 2014-10-12 18:07 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hunted The Demon's Forge.html | 2014-10-12 18:20 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dragon Ball Z Burst Limit.html | 2014-10-12 18:19 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Prince of Persia Rival Swords.html | 2014-10-12 18:14 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NBA 2K15.html | 2014-10-12 18:06 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_LEGO Star Wars III The Clone Wars.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Teenage Mutant Ninja Turtles Smash-Up.html | 2014-10-12 18:15 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Night at the Museum Battle of the Smithsonian.html | 2014-10-12 18:14 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Crash Mind Over Mutant.html | 2014-10-12 18:01 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sonic Unleashed.html | 2014-10-12 18:23 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tony Hawk's Project 8.html | 2014-10-12 18:10 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cloudy With a Chance of Meatballs.html | 2014-10-12 18:11 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_WWE '12.html | 2014-10-12 18:25 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ice Age 2 The Meltdown.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_James Cameron's Avatar The Game.html | 2014-10-12 18:05 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Lost Planet Extreme Condition.html | 2014-10-12 18:05 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ben 10 Protector of Earth.html | 2014-10-12 18:11 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dead Rising Chop Till You Drop.html | 2014-10-12 18:12 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Spec Ops The Line.html | 2014-10-12 18:08 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_No More Heroes 2 Desperate Struggle.html | 2014-10-12 18:14 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Mario Party 8.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_MX vs. ATV Untamed.html | 2014-10-12 18:14 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Wii Music.html | 2014-10-12 18:16 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Sims 3.html | 2014-10-12 18:16 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Cabela's Alaskan Adventures.html | 2014-10-12 18:00 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Call of Duty Advanced Warfare.html | 2014-10-12 18:18 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_EA Sports Active.html | 2014-10-12 18:12 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Call of Duty Advanced Warfare.html | 2014-10-12 18:00 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_BioShock Infinite.html | 2014-10-12 18:17 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Plants vs. Zombies.html | 2014-10-12 18:07 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rampage Total Destruction.html | 2014-10-12 18:14 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Just Dance 3.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_G.I. Joe The Rise of Cobra.html | 2014-10-12 18:04 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_G.I. Joe The Rise of Cobra.html | 2014-10-12 18:19 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Army of Two The 40th Day.html | 2014-10-12 17:59 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Link's Crossbow Training.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Klonoa.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Toy Story Mania!.html | 2014-10-12 18:16 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Assassin's Creed III Liberation HD.html | 2014-10-12 17:59 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Halo Combat Evolved Anniversary.html | 2014-10-12 18:04 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tiger Woods PGA Tour 09.html | 2014-10-12 18:10 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Excitebots Trick Racing.html | 2014-10-12 18:12 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Spider-Man 3.html | 2014-10-12 18:08 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Lord of the Rings The Battle for Middle-Earth II.html | 2014-10-12 18:09 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Batman Arkham Origins Blackgate Deluxe Edition.html | 2014-10-12 18:17 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Cars.html | 2014-10-12 18:00 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Eye of Judgment.html | 2014-10-12 18:24 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Elder Scrolls IV Oblivion.html | 2014-10-12 18:09 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Little Big Planet 3.html | 2014-10-12 18:20 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_NBA 2K10.html | 2014-10-12 18:14 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Batman Arkham Origins Blackgate Deluxe Edition.html | 2014-10-12 17:59 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Up.html | 2014-10-12 18:24 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Virtua Fighter 5.html | 2014-10-12 18:25 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Golden Compass.html | 2014-10-12 18:24 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Naruto Shippuden Ultimate Ninja Storm 3.html | 2014-10-12 18:21 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sid Meier's Civilization Revolution.html | 2014-10-12 18:23 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_WALL-E.html | 2014-10-12 18:25 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_WALL-E.html | 2014-10-12 18:10 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Twisted Metal.html | 2014-10-12 18:24 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Unreal Tournament 3.html | 2014-10-12 18:24 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Soul Calibur Legends.html | 2014-10-12 18:15 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_X-Men Origins Wolverine.html | 2014-10-12 18:10 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_X-Men Origins Wolverine.html | 2014-10-12 18:25 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Mirror's Edge.html | 2014-10-12 18:06 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Raving Rabbids - Party Collection.html | 2014-10-12 18:14 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_TMNT.html | 2014-10-12 18:10 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Condemned Criminal Origins.html | 2014-10-12 18:01 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Burnout Paradise.html | 2014-10-12 18:00 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Resident Evil The Umbrella Chronicles.html | 2014-10-12 18:14 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Mario Sports Mix.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Tiger Woods PGA Tour 07.html | 2014-10-12 18:16 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Top Spin 2.html | 2014-10-12 18:10 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_WWE '13.html | 2014-10-12 18:25 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_All-Pro Football 2K8.html | 2014-10-12 17:59 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Guitar Hero Metallica.html | 2014-10-12 18:04 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_CSI Deadly Intent.html | 2014-10-12 18:01 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NBA Jam.html | 2014-10-12 18:21 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Jeopardy!.html | 2014-10-12 18:05 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Endless Ocean.html | 2014-10-12 18:12 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_SimCity Creator.html | 2014-10-12 18:15 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tom Clancy's Ghost Recon Advanced Warfighter.html | 2014-10-12 18:10 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_LittleBigPlanet Game Of The Year Edition.html | 2014-10-12 18:20 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Resonance of Fate.html | 2014-10-12 18:22 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_MLB Power Pros 2008.html | 2014-10-12 18:13 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_FlingSmash.html | 2014-10-12 18:12 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NHL 07.html | 2014-10-12 18:06 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Viking Battle for Asgard.html | 2014-10-12 18:10 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Record of Agarest War Zero.html | 2014-10-12 18:07 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_MX vs. ATV Untamed.html | 2014-10-12 18:21 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dragon Ball Z Budokai Tenkaichi 2.html | 2014-10-12 18:12 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Pure.html | 2014-10-12 18:07 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Harry Potter and the Order of the Phoenix.html | 2014-10-12 18:20 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Brothers in Arms Hell's Highway.html | 2014-10-12 18:18 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dark Souls.html | 2014-10-12 18:18 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_BlazeRush.html | 2014-10-12 18:17 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Def Jam Icon.html | 2014-10-12 18:02 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Naruto Clash of Ninja Revolution 2.html | 2014-10-12 18:14 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ace Combat Assault Horizon.html | 2014-10-12 18:17 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Safecracker.html | 2014-10-12 18:15 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cosmic Family.html | 2014-10-12 18:11 | 44K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tekken Tag Tournament 2.html | 2014-10-12 18:24 | 44K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Godfather The Game.html | 2014-10-12 18:09 | 44K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Mario & Sonic at the Olympic Games.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Bomberman Land.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Tiger Woods PGA Tour 09 All Play.html | 2014-10-12 18:16 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dead Space 3.html | 2014-10-12 18:18 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Tony Hawk's Downhill Jam.html | 2014-10-12 18:16 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Sonic and the Secret Rings.html | 2014-10-12 18:15 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Portal 2.html | 2014-10-12 18:07 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Little King's Story.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fable Anniversary.html | 2014-10-12 18:04 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Beijing 2008.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Top Spin 3.html | 2014-10-12 18:16 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Beijing 2008.html | 2014-10-12 17:59 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Machinarium.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rune Factory Frontier.html | 2014-10-12 18:15 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rapala's Fishing Frenzy.html | 2014-10-12 18:14 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dragon's Dogma.html | 2014-10-12 18:03 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Super Monkey Ball Banana Blitz.html | 2014-10-12 18:15 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Kororinpa Marble Mania.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Yakuza 3.html | 2014-10-12 18:25 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cursed Mountain.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Puppeteer.html | 2014-10-12 18:22 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_X-Men Destiny.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Back to the Future The Game.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Marvel vs. Capcom 3 Fate of Two Worlds (Special Edition).html | 2014-10-12 18:21 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Armored Core 4.html | 2014-10-12 17:59 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fable II.html | 2014-10-12 18:04 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dance Dance Revolution Disney Grooves.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Excite Truck.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Transformers War for Cybertron.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Donkey Kong Barrel Blast.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Chronicles of Riddick Assault on Dark Athena.html | 2014-10-12 18:18 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Michael Jackson The Experience.html | 2014-10-12 18:06 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Deadlight.html | 2014-10-12 18:02 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ninja Gaiden II.html | 2014-10-12 18:07 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Overlord Raising Hell.html | 2014-10-12 18:22 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Call of Duty Black Ops.html | 2014-10-12 18:00 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Tiger Woods PGA Tour 11.html | 2014-10-12 18:16 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Catherine.html | 2014-10-12 18:01 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Bully Scholarship Edition.html | 2014-10-12 18:00 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Madden NFL 10.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tomb Raider Legend.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Wet.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Michael Jackson The Experience.html | 2014-10-12 18:21 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Infamous 2.html | 2014-10-12 18:20 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dance Dance Revolution Hottest Party.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Starhawk.html | 2014-10-12 18:24 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Sonic & SEGA All-Stars Racing.html | 2014-10-12 18:15 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Saints Row The Third The Full Package.html | 2014-10-12 18:08 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Thief.html | 2014-10-12 18:24 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Warhammer 40,000 Space Marine.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Lost Odyssey.html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cooking Mama.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Guitar Hero Van Halen.html | 2014-10-12 18:20 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Final Fantasy X X-2 HD Remaster Limited Edition.html | 2014-10-12 18:19 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dead Island Riptide.html | 2014-10-12 18:18 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Metal Gear Solid V Ground Zeroes.html | 2014-10-12 18:21 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Virtua Tennis 2009.html | 2014-10-12 18:16 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Alice Madness Returns.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ghost Squad.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Destroy All Humans! Big Willy Unleashed.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Guitar Hero II.html | 2014-10-12 18:04 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_F1 2012.html | 2014-10-12 18:04 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Wheel of Fortune.html | 2014-10-12 18:16 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_South Park The Stick of Truth.html | 2014-10-12 18:08 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Mushroom Men.html | 2014-10-12 18:14 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Prototype.html | 2014-10-12 18:07 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rock Band.html | 2014-10-12 18:14 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Disney Epic Mickey 2 The Power of Two.html | 2014-10-12 18:18 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_How to Train Your Dragon.html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Castlevania Lords of Shadow Collector's Edition.html | 2014-10-12 18:18 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Castlevania Lords of Shadow Collector's Edition.html | 2014-10-12 18:00 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Call of Duty World at War.html | 2014-10-12 18:18 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Sam & Max Save the World.html | 2014-10-12 18:15 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Spider-Man Edge of Time.html | 2014-10-12 18:09 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Darksiders II.html | 2014-10-12 18:02 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Disney Epic Mickey 2 The Power of Two.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Borderlands - Game of the Year Edition.html | 2014-10-12 18:00 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Harry Potter and the Deathly Hallows Part 1.html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Need for Speed Shift.html | 2014-10-12 18:06 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Banjo-Kazooie Nuts & Bolts.html | 2014-10-12 17:59 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dante's Inferno.html | 2014-10-12 18:18 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Who Wants to be a Millionaire 1st Edition.html | 2014-10-12 18:16 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Geometry Wars Galaxies.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SOCOM U.S. Navy SEALs Confrontation.html | 2014-10-12 18:23 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Metal Gear Solid V Ground Zeroes.html | 2014-10-12 18:06 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Just Cause.html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Sesame Street Cookie's Counting Carnival.html | 2014-10-12 18:15 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_WWE SmackDown vs. Raw 2011.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Army Men Soldiers of Misfortune.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Phantasy Star Universe.html | 2014-10-12 18:07 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Brothers in Arms Hell's Highway.html | 2014-10-12 18:00 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Tiger Woods PGA Tour 10.html | 2014-10-12 18:16 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_LEGO Star Wars III The Clone Wars.html | 2014-10-12 18:20 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Samurai Warriors Katana.html | 2014-10-12 18:15 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Virtua Fighter 5 Online.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Warhawk.html | 2014-10-12 18:25 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Prince of Persia (2008).html | 2014-10-12 18:22 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Deadly Creatures.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_We Ski.html | 2014-10-12 18:16 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_NHL Slapshot.html | 2014-10-12 18:14 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Super Mario All-Stars 25th Anniversary Edition.html | 2014-10-12 18:15 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Carrier Command Gaea Mission.html | 2014-10-12 18:00 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Blazing Angels 2 Secret Missions of WWII.html | 2014-10-12 17:59 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NBA Live 08.html | 2014-10-12 18:06 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Astro Boy.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Velvet Assassin.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Wheel of Fortune.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dead Space 2.html | 2014-10-12 18:02 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dragon Age Origins.html | 2014-10-12 18:19 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Big Beach Sports.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Brunswick Pro Bowling.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Call of Duty Black Ops II.html | 2014-10-12 18:00 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Hitman Blood Money.html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Burnout Revenge.html | 2014-10-12 18:00 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Sonic Riders Zero Gravity.html | 2014-10-12 18:15 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dark Souls.html | 2014-10-12 18:02 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_DJ Hero 2.html | 2014-10-12 18:03 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Resistance 2.html | 2014-10-12 18:22 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Burnout Paradise.html | 2014-10-12 18:18 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Aquanaut's Holiday Hidden Memories.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Elebits.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Deca Sports.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NBA Live 06.html | 2014-10-12 18:06 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Mercury Meltdown Revolution.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_LEGO Batman 2 DC Super Heroes.html | 2014-10-12 18:20 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_F1 2010.html | 2014-10-12 18:19 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Transformers Cybertron Adventures.html | 2014-10-12 18:16 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_LEGO Harry Potter Years 1-4.html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NBA 2K9.html | 2014-10-12 18:06 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Sonic and the Black Knight.html | 2014-10-12 18:15 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Agatha Christie And Then There Were None.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_LEGO The Lord of the Rings.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Naruto Shippuden Ultimate Ninja Storm 2.html | 2014-10-12 18:06 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tiger Woods PGA Tour 06.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_You Don't Know Jack.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_GRID Autosport.html | 2014-10-12 18:19 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_GRID Autosport.html | 2014-10-12 18:04 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Forza Horizon.html | 2014-10-12 18:04 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Worms A Space Oddity.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Godzilla Unleashed.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Castlevania Lords of Shadow.html | 2014-10-12 18:00 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dragon Age Origins.html | 2014-10-12 18:03 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Madden NFL 09 All-Play.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Call of Duty 2.html | 2014-10-12 18:00 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tom Clancy's Ghost Recon Advanced Warfighter 2.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Chronicles of Riddick Assault on Dark Athena.html | 2014-10-12 18:01 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Guitar Hero Aerosmith.html | 2014-10-12 18:04 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_X-Men Destiny.html | 2014-10-12 18:25 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Mini Ninjas.html | 2014-10-12 18:06 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Forza Motorsport 4.html | 2014-10-12 18:04 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Army of Two The 40th Day.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_CSI Hard Evidence.html | 2014-10-12 18:01 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fable II (Platinum Hits).html | 2014-10-12 18:04 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Overlord.html | 2014-10-12 18:07 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Resident Evil 5.html | 2014-10-12 18:22 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Strong Bad's Cool Game for Attractive People.html | 2014-10-12 18:15 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_ObsCure The Aftermath.html | 2014-10-12 18:14 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Monster 4x4 World Circuit.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Star Wars The Clone Wars Lightsaber Duels.html | 2014-10-12 18:15 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Beautiful Katamari.html | 2014-10-12 17:59 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Terminator Salvation.html | 2014-10-12 18:09 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Skate 2.html | 2014-10-12 18:08 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Remember Me.html | 2014-10-12 18:07 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_WWE SmackDown vs. Raw 2009.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rayman Origins.html | 2014-10-12 18:22 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_WWE SmackDown vs. Raw 2009.html | 2014-10-12 18:25 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Viking Battle for Asgard.html | 2014-10-12 18:25 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Wii Chess.html | 2014-10-12 18:16 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Tournament of Legends.html | 2014-10-12 18:16 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Untold Legends Dark Kingdom.html | 2014-10-12 18:24 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Marvel vs. Capcom 3 Fate of Two Worlds (Special Edition).html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dying Light.html | 2014-10-12 18:19 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Final Fantasy Crystal Chronicles My Life as a King.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ultra Street Fighter IV.html | 2014-10-12 18:24 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ultra Street Fighter IV.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_National Geographic Challenge!.html | 2014-10-12 18:06 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dragon Age Origins - Ultimate Edition.html | 2014-10-12 18:03 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Lair.html | 2014-10-12 18:20 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Cabela's Dangerous Hunts 2011.html | 2014-10-12 18:00 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_BlazBlue Continuum Shift.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Deal or No Deal.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Aladdin Magic Racer.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Sly Collection.html | 2014-10-12 18:24 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rio.html | 2014-10-12 18:14 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Child of Light.html | 2014-10-12 18:18 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Child of Light.html | 2014-10-12 18:01 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Driver San Francisco.html | 2014-10-12 18:19 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_LEGO Star Wars III The Clone Wars.html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Prince of Persia.html | 2014-10-12 18:22 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Disney Epic Mickey 2 The Power of Two.html | 2014-10-12 18:03 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_WWE SmackDown vs. Raw 2009.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Viva Piñata.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Eragon.html | 2014-10-12 18:04 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NHL 2K7.html | 2014-10-12 18:07 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Hitman Absolution.html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_M&M's Kart Racing.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tales of Graces f.html | 2014-10-12 18:24 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Transformers The Game.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Mayhem.html | 2014-10-12 18:06 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Colin McRae DiRT.html | 2014-10-12 18:01 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Alvin and the Chipmunks.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tony Hawk's Proving Ground.html | 2014-10-12 18:24 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Just Dance 2.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_AC DC Live Rock Band Track Pack.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Open Season.html | 2014-10-12 18:07 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Wii Play.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Amazing Spider-Man.html | 2014-10-12 18:24 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Call of Duty Modern Warfare 2.html | 2014-10-12 18:00 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Jenga World Tour.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Shaun White Snowboarding.html | 2014-10-12 18:23 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Raven Squad Operation Hidden Dagger.html | 2014-10-12 18:07 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dynasty Warriors Gundam.html | 2014-10-12 18:19 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Major League Baseball 2K12.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Your Shape Fitness Evolved.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mafia II.html | 2014-10-12 18:20 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Mafia II.html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_MLB Power Pros.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Darksiders II.html | 2014-10-12 18:18 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Spider-Man Friend or Foe.html | 2014-10-12 18:09 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rogue Warrior.html | 2014-10-12 18:23 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rogue Warrior.html | 2014-10-12 18:08 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_SSX Blur.html | 2014-10-12 18:15 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Naruto Shippuden Ultimate Ninja Storm 2.html | 2014-10-12 18:21 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Agatha Christie Evil Under the Sun.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_God of War Ascension.html | 2014-10-12 18:19 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_LEGO Indiana Jones 2 The Adventure Continues.html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Assassin's Creed Brotherhood.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_BioShock 2.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Alien Isolation.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Alien Isolation.html | 2014-10-12 17:59 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_BlazBlue Calamity Trigger.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Prototype.html | 2014-10-12 18:22 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_WWE '12.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ten Pin Alley 2.html | 2014-10-12 18:15 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Record of Agarest War Zero.html | 2014-10-12 18:22 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Green Lantern Rise of the Manhunters.html | 2014-10-12 18:04 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_X-Blades.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Silent Hill HD Collection.html | 2014-10-12 18:08 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dynasty Warriors 6.html | 2014-10-12 18:03 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Lord of the Rings The Battle For Middle-Earth II.html | 2014-10-12 18:09 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Saints Row The Third.html | 2014-10-12 18:08 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Assassin's Creed III.html | 2014-10-12 17:59 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Yakuza Dead Souls.html | 2014-10-12 18:25 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Singularity.html | 2014-10-12 18:23 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Just Cause 2.html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Just Cause 2.html | 2014-10-12 18:20 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Super Swing Golf.html | 2014-10-12 18:15 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Metro 2033.html | 2014-10-12 18:06 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dead Island Riptide.html | 2014-10-12 18:02 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Heavenly Guardian.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NHL 09.html | 2014-10-12 18:06 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The King of Fighters XII.html | 2014-10-12 18:24 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Action Girlz Racing.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_XBOX Live Arcade Compilation Disc.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Boom Blox.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NHL 08.html | 2014-10-12 18:06 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Captain America Super Soldier.html | 2014-10-12 18:18 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Samurai Warriors 2.html | 2014-10-12 18:08 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Blitz The League.html | 2014-10-12 17:59 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Assassin's Creed IV Black Flag.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Harry Potter and the Half-Blood Prince.html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Guitar Hero 5.html | 2014-10-12 18:04 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Don King Boxing.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Monster Jam Path of Destruction.html | 2014-10-12 18:06 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Brothers in Arms Double Time.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_LEGO Harry Potter Years 5-7.html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Duke Nukem Forever.html | 2014-10-12 18:19 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NASCAR The Game 2011.html | 2014-10-12 18:06 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The House of the Dead 2 & 3 Return.html | 2014-10-12 18:16 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Oddworld New n Tasty.html | 2014-10-12 18:22 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fable II (Limited Collector's Edition).html | 2014-10-12 18:04 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_WWE All Stars.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Virtua Tennis 3.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Boogie.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Madden NFL 09.html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_World Championship Poker Featuring Howard Lederer.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Bust-A-Move Bash!.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Barbie as the Island Princess.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Chaotic Shadow Warriors.html | 2014-10-12 18:01 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Winter Sports The Ultimate Challenge.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Bit.Trip Complete.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Bladestorm The Hundred Years' War.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NHL 11.html | 2014-10-12 18:21 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NHL 11.html | 2014-10-12 18:06 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Kung Fu Panda.html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NHL 2K10.html | 2014-10-12 18:07 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tom Clancy's H.A.W.X.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Pac-Man Party.html | 2014-10-12 18:14 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Street Fighter IV.html | 2014-10-12 18:09 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Final Fantasy Crystal Chronicles My Life as a Dark Lord.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Grand Theft Auto V (Special Edition).html | 2014-10-12 18:04 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Battlestations Midway.html | 2014-10-12 17:59 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Balloon Pop.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_UFC Personal Trainer.html | 2014-10-12 18:16 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Condemned 2 Bloodshot.html | 2014-10-12 18:01 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ultimate Mortal Kombat 3.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rage.html | 2014-10-12 18:07 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Red Steel.html | 2014-10-12 18:14 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dark Souls II.html | 2014-10-12 18:02 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Crackdown 2.html | 2014-10-12 18:01 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Harry Potter and the Half-Blood Prince.html | 2014-10-12 18:20 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NHL 2K9.html | 2014-10-12 18:07 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Madden NFL 07.html | 2014-10-12 18:20 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Golden Axe Beast Rider.html | 2014-10-12 18:19 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Army of Two.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Star Ocean The Last Hope.html | 2014-10-12 18:23 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Armored Core 4.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Legend of the Dragon.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Robert Ludlum's The Bourne Conspiracy.html | 2014-10-12 18:22 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Shaun White Snowboarding World Stage.html | 2014-10-12 18:15 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Remember Me.html | 2014-10-12 18:22 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cooking Mama World Kitchen.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Condemned 2 Bloodshot.html | 2014-10-12 18:18 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Soul Calibur V.html | 2014-10-12 18:23 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_F1 2014.html | 2014-10-12 18:19 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tempete de Boulettes Geantes.html | 2014-10-12 18:09 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_F1 2014.html | 2014-10-12 18:04 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_FaceBreaker.html | 2014-10-12 18:04 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Puzzle Quest Challenge of the Warlords.html | 2014-10-12 18:07 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Prince of Persia (2008) Limited Edition.html | 2014-10-12 18:22 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Need for Speed Undercover.html | 2014-10-12 18:21 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Command & Conquer Red Alert 3 Ultimate Edition.html | 2014-10-12 18:18 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Harry Potter and the Order of the Phoenix.html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Soul Calibur IV.html | 2014-10-12 18:23 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sacred 2 Fallen Angel.html | 2014-10-12 18:08 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Tamagotchi Party On!.html | 2014-10-12 18:15 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Guitar Hero Metallica.html | 2014-10-12 18:20 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Worms Battle Islands.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Pro Evolution Soccer 2013.html | 2014-10-12 18:22 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Black Eyed Peas Experience.html | 2014-10-12 18:09 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_TNA Impact.html | 2014-10-12 18:16 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Super Street Fighter IV Arcade Edition.html | 2014-10-12 18:09 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NCAA Football 08.html | 2014-10-12 18:21 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cabela's Outdoor Adventures.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Superman Returns.html | 2014-10-12 18:09 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Jimmie Johnson's Anything with an Engine.html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_GoldenEye 007 Reloaded.html | 2014-10-12 18:04 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Super Mario All-Stars Wii.html | 2014-10-12 18:15 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Saints Row 2.html | 2014-10-12 18:08 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dynasty Warriors 6.html | 2014-10-12 18:19 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tom Clancy's Ghost Recon Advanced Warfighter 2.html | 2014-10-12 18:24 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Need for Speed Most Wanted.html | 2014-10-12 18:21 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_DmC Devil May Cry.html | 2014-10-12 18:18 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Spiderwick Chronicles.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Pro Evolution Soccer 2010.html | 2014-10-12 18:22 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NCAA Football 08.html | 2014-10-12 18:06 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Terminator Salvation.html | 2014-10-12 18:24 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Fishing Master.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Major League Baseball 2K6.html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Big Brain Academy Wii Degree.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Valhalla Knights Eldar Saga.html | 2014-10-12 18:16 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sine Mora.html | 2014-10-12 18:23 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_LEGO Harry Potter Years 5-7.html | 2014-10-12 18:20 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Adrenalin Misfits.html | 2014-10-12 17:59 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Game Party 2.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Hour of Victory.html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Beatles Rock Band.html | 2014-10-12 18:09 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_We Dare.html | 2014-10-12 18:16 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Wolfenstein The New Order.html | 2014-10-12 18:25 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_LEGO The Lord of the Rings.html | 2014-10-12 18:20 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_James Cameron's Avatar The Game.html | 2014-10-12 18:20 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_World of Outlaws Sprint Cars.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Onechanbara Bikini Samurai Squad.html | 2014-10-12 18:07 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rapala Pro Bass Fishing.html | 2014-10-12 18:14 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Wolfenstein The New Order.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sniper Elite III.html | 2014-10-12 18:23 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sniper Elite III.html | 2014-10-12 18:08 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Bigs.html | 2014-10-12 18:09 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NBA Live 07.html | 2014-10-12 18:06 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dynasty Warriors 8.html | 2014-10-12 18:03 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Cartoon Network Punch Time Explosion XL.html | 2014-10-12 18:00 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dark Souls II.html | 2014-10-12 18:18 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Batman Arkham Asylum Game of the Year Edition.html | 2014-10-12 17:59 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Resident Evil 5.html | 2014-10-12 18:07 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Call of Duty Modern Warfare 3 Hardened Edition.html | 2014-10-12 18:00 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Pro Evolution Soccer 2013.html | 2014-10-12 18:07 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Asterix at the Olympic Games.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Duke Nukem Forever.html | 2014-10-12 18:03 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Pro Evolution Soccer 6.html | 2014-10-12 18:07 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dark Sector.html | 2014-10-12 18:18 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_I Am Alive.html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Beyond Two Souls.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Brütal Legend.html | 2014-10-12 18:00 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Pitfall The Big Adventure.html | 2014-10-12 18:14 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Soul Calibur IV.html | 2014-10-12 18:08 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Transformers Dark of the Moon.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Crackdown.html | 2014-10-12 18:01 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Over G Fighters.html | 2014-10-12 18:07 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Major League Baseball 2K10.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_All Star Karate.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NCAA Football 10.html | 2014-10-12 18:06 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Enslaved Odyssey to the West.html | 2014-10-12 18:19 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Command & Conquer 3 Tiberium Wars.html | 2014-10-12 18:01 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cooking Mama Cook Off.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Nerf N-Strike.html | 2014-10-12 18:14 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Beowulf The Game.html | 2014-10-12 17:59 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fairytale Fights.html | 2014-10-12 18:04 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_101-in-1 Party Megamix.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Star Ocean The Last Hope.html | 2014-10-12 18:09 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sly Cooper Thieves in Time.html | 2014-10-12 18:23 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Wing Island.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_MySims Kingdom.html | 2014-10-12 18:14 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Bigs 2.html | 2014-10-12 18:15 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Major League Baseball 2K11.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Final Fantasy XI Online.html | 2014-10-12 18:04 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Red Faction Guerrilla.html | 2014-10-12 18:22 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Batman The Brave and the Bold The Videogame.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rapala Tournament Fishing.html | 2014-10-12 18:14 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Just Dance Kids 2.html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Naruto Clash of Ninja Revolution.html | 2014-10-12 18:14 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rock Band.html | 2014-10-12 18:08 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dynasty Warriors Gundam.html | 2014-10-12 18:03 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Clive Barker's Jericho.html | 2014-10-12 18:18 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Earth Defense Force Insect Armageddon.html | 2014-10-12 18:03 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_LEGO The Lord of the Rings.html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_FIFA Street.html | 2014-10-12 18:19 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Need for Speed The Run.html | 2014-10-12 18:21 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Disney Infinity.html | 2014-10-12 18:18 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Colin McRae DiRT 2.html | 2014-10-12 18:18 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Batman Arkham City Game of the Year Edition.html | 2014-10-12 17:59 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Pro Evolution Soccer 2013.html | 2014-10-12 18:14 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ninja Gaiden Sigma.html | 2014-10-12 18:22 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Cursed Crusade.html | 2014-10-12 18:09 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Virtua Tennis 3.html | 2014-10-12 18:25 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Madden NFL 11.html | 2014-10-12 18:20 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Monster High Ghoul Spirit.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Persona 4 Arena.html | 2014-10-12 18:07 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Robert Ludlum's The Bourne Conspiracy.html | 2014-10-12 18:07 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Borderlands The Pre-Sequel.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Syndicate.html | 2014-10-12 18:09 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Borderlands The Pre-Sequel.html | 2014-10-12 18:00 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Syndicate.html | 2014-10-12 18:24 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Resident Evil 5 Gold Edition.html | 2014-10-12 18:07 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dino Strike.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Green Day Rock Band.html | 2014-10-12 18:19 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dora Saves the Snow Princess.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_BlazBlue Chrono Phantasma.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fight Night Champion.html | 2014-10-12 18:04 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dead Rising 2.html | 2014-10-12 18:02 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Are You Smarter than a 5th Grader Game Time.html | 2014-10-12 17:59 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Star Trek Conquest.html | 2014-10-12 18:15 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_F1 2009.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NHL 09.html | 2014-10-12 18:21 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Escape from Bug Island.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Smurfs Dance Party.html | 2014-10-12 18:16 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tales of Symphonia Chronicles.html | 2014-10-12 18:24 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Evil Within.html | 2014-10-12 18:24 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Evil Within.html | 2014-10-12 18:09 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dead Space 3.html | 2014-10-12 18:02 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Trials Fusion.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Frontlines Fuel of War.html | 2014-10-12 18:04 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Devil May Cry 4.html | 2014-10-12 18:03 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ice Age Dawn of the Dinosaurs.html | 2014-10-12 18:05 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Alone in the Dark Inferno.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Enchanted Arms.html | 2014-10-12 18:03 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ice Age Dawn of the Dinosaurs.html | 2014-10-12 18:20 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Need for Speed The Run.html | 2014-10-12 18:14 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Go, Diego, Go! Safari Rescue.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ice Age Dawn of the Dinosaurs.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_FIFA Soccer 11.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Binary Domain.html | 2014-10-12 17:59 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dead Rising 2 Off The Record.html | 2014-10-12 18:18 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Prince of Persia Trilogy HD.html | 2014-10-12 18:22 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NBA Street Homecourt.html | 2014-10-12 18:06 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Harry Potter and the Deathly Hallows Part 1.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Time Crisis 4.html | 2014-10-12 18:24 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Wreck-It Ralph.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Murdered Soul Suspect.html | 2014-10-12 18:21 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Murdered Soul Suspect.html | 2014-10-12 18:06 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Yoostar 2 In the Movies.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_ModNation Racers.html | 2014-10-12 18:21 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_EA Sports Active 2.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_2006 FIFA World Cup.html | 2014-10-12 17:59 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Silent Hill Downpour.html | 2014-10-12 18:23 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Marvel Ultimate Alliance.html | 2014-10-12 18:21 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The King of Fighters XIII.html | 2014-10-12 18:09 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Blue Dragon.html | 2014-10-12 17:59 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NBA 2K8.html | 2014-10-12 18:21 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NBA 2K8.html | 2014-10-12 18:06 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Samurai Warriors 2 Empires.html | 2014-10-12 18:08 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ready 2 Rumble Revolution.html | 2014-10-12 18:14 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Driver San Francisco.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Game Party 3.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rockstar Games Presents Table Tennis.html | 2014-10-12 18:14 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cruis'n.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Cabela's Adventure Camp.html | 2014-10-12 18:18 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Need for Speed Hot Pursuit.html | 2014-10-12 18:14 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Colin McRae DiRT 2.html | 2014-10-12 18:01 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_FIFA 15.html | 2014-10-12 18:12 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Trinity Souls Of Zill O'll.html | 2014-10-12 18:24 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Aliens vs. Predator.html | 2014-10-12 17:59 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_TimeShift.html | 2014-10-12 18:24 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Machinarium.html | 2014-10-12 18:20 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dragon's Dogma Dark Arisen.html | 2014-10-12 18:19 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Soldier of Fortune Payback.html | 2014-10-12 18:08 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Enemy Territory Quake Wars.html | 2014-10-12 18:03 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Hannah Montana Spotlight World Tour.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Battleship.html | 2014-10-12 18:17 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Battleship.html | 2014-10-12 17:59 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_FIFA 12.html | 2014-10-12 18:19 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Shank 2.html | 2014-10-12 18:08 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Darkness.html | 2014-10-12 18:24 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_TimeShift.html | 2014-10-12 18:10 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dragon's Dogma Dark Arisen.html | 2014-10-12 18:03 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Club.html | 2014-10-12 18:24 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dragon's Crown.html | 2014-10-12 18:19 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Monopoly Streets.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hellboy The Science of Evil.html | 2014-10-12 18:20 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Spiderwick Chronicles.html | 2014-10-12 18:16 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_I Spy Spooky Mansion.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Battleship.html | 2014-10-12 18:11 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Namco Museum Remix.html | 2014-10-12 18:14 | 43K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Hasbro Family Game Night.html | 2014-10-12 18:13 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dead Rising.html | 2014-10-12 18:02 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dragon Ball Raging Blast 2.html | 2014-10-12 18:19 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Red Faction Armageddon.html | 2014-10-12 18:22 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Nicktoons MLB.html | 2014-10-12 18:07 | 43K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Cave.html | 2014-10-12 18:09 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Final Fantasy XIV.html | 2014-10-12 18:19 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_LEGO Indiana Jones 2 The Adventure Continues.html | 2014-10-12 18:20 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_God of War Collection.html | 2014-10-12 18:19 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Deus Ex Human Revolution.html | 2014-10-12 18:18 | 43K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Guitar Hero World Tour.html | 2014-10-12 18:20 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_LEGO Batman 2 DC Super Heroes.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Winter Stars.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Wet.html | 2014-10-12 18:25 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Medal of Honor Airborne.html | 2014-10-12 18:06 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Don Bradman Cricket.html | 2014-10-12 18:03 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Bureau XCOM Declassified.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Guitar Hero Aerosmith.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Bureau XCOM Declassified.html | 2014-10-12 18:09 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Quake 4.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_LEGO The Hobbit.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Maximum Racing Super Truck Racer.html | 2014-10-12 18:13 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Vanquish.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Silent Hill Downpour.html | 2014-10-12 18:08 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NCAA Football 11.html | 2014-10-12 18:06 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Project Gotham Racing 4.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Madden NFL 15.html | 2014-10-12 18:20 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Minecraft.html | 2014-10-12 18:06 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Colin McRae DiRT.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Madden NFL 15.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Kingdom Hearts HD 1.5 ReMIX.html | 2014-10-12 18:20 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Stranglehold.html | 2014-10-12 18:09 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_MX vs. ATV Alive.html | 2014-10-12 18:06 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Star Trek Legacy.html | 2014-10-12 18:09 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Wii Sports and Wii Sports Resort.html | 2014-10-12 18:17 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Kane & Lynch Dead Men.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sleeping Dogs.html | 2014-10-12 18:23 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Call of Juarez Cartel.html | 2014-10-12 18:00 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Clive Barker's Jericho.html | 2014-10-12 18:01 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dead Island.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Doom 3 BFG Edition.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Pro Evolution Soccer 2011.html | 2014-10-12 18:14 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Hooked! Real Motion Fishing.html | 2014-10-12 18:13 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rango.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Kawasaki Jet Ski.html | 2014-10-12 18:13 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Deca Sports 2.html | 2014-10-12 18:12 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Gran Turismo 5 Prologue.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Chicken Shoot.html | 2014-10-12 18:11 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Tron Evolution – Battle Grids.html | 2014-10-12 18:16 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Castle Crashers.html | 2014-10-12 18:00 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_World Series of Poker Tournament of Champions.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Marvel vs. Capcom 3 Fate of Two Worlds.html | 2014-10-12 18:21 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Your Shape Fitness Evolved 2012.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Konami Classics Vol. 1.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Guitar Hero Smash Hits.html | 2014-10-12 18:04 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tiger Woods PGA Tour 08.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Alpha Protocol.html | 2014-10-12 17:59 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Don King Presents Prizefighter.html | 2014-10-12 18:03 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Drakengard 3.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rock Band 3.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sonic & All-Stars Racing Transformed.html | 2014-10-12 18:23 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Pinball Hall of Fame The Williams Collection.html | 2014-10-12 18:22 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Far Cry 3.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_BlackSite Area 51.html | 2014-10-12 17:59 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Jak and Daxter Collection.html | 2014-10-12 18:20 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Just Dance Kids 2014.html | 2014-10-12 18:13 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Lost Planet 3.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Vampire Rain.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_AMF Bowling Pinbusters!.html | 2014-10-12 18:11 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Final Fantasy Crystal Chronicles Echoes of Time.html | 2014-10-12 18:12 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Swapper.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_All Star Cheer Squad.html | 2014-10-12 18:11 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Disney Epic Mickey Collector's Edition.html | 2014-10-12 18:12 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Pinball Hall of Fame The Williams Collection.html | 2014-10-12 18:14 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_College Hoops 2K7.html | 2014-10-12 18:01 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_College Hoops 2K8.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_College Hoops 2K8.html | 2014-10-12 18:01 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Inazuma Eleven Strikers.html | 2014-10-12 18:13 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Cloudy With a Chance of Meatballs.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Guided Fate Paradox.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dessine ton Aventure.html | 2014-10-12 18:12 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Siren Blood Curse.html | 2014-10-12 18:23 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ducktales Remastered.html | 2014-10-12 18:03 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Madden NFL 08.html | 2014-10-12 18:20 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Stuntman Ignition.html | 2014-10-12 18:09 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Overlord II.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Big Catch Bass Fishing.html | 2014-10-12 18:11 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Lord of the Rings Conquest.html | 2014-10-12 18:09 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Beyond the Future Fix the Time Arrows.html | 2014-10-12 18:17 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_NASCAR Kart Racing.html | 2014-10-12 18:14 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Resident Evil 6.html | 2014-10-12 18:22 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NHL 2K8.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Munchables.html | 2014-10-12 18:16 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_UFC Undisputed 3.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Kameo Elements of Power.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Eternal Sonata.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Anomaly Warzone Earth.html | 2014-10-12 18:17 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Anomaly Warzone Earth.html | 2014-10-12 17:59 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Resident Evil Archives Resident Evil 0.html | 2014-10-12 18:14 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Darkness.html | 2014-10-12 18:09 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Major League Baseball 2K12.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_MAG.html | 2014-10-12 18:20 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_WWE '13.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dead Rising 2.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dragon Ball Z Ultimate Tenkaichi.html | 2014-10-12 18:03 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_WWE SmackDown vs. Raw 2011.html | 2014-10-12 18:17 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dunamis 15.html | 2014-10-12 18:03 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Super Street Fighter IV Arcade Edition.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Pro Evolution Soccer 2007.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Sims 3.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Need for Speed Most Wanted.html | 2014-10-12 18:06 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Majin and the Forsaken Kingdom.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dragon Ball Z Burst Limit.html | 2014-10-12 18:03 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_World Championship Poker Featuring Howard Lederer - All In.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Mega Man 10.html | 2014-10-12 18:13 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Assassin's Creed Rogue.html | 2014-10-12 18:17 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Just Dance.html | 2014-10-12 18:13 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Naruto Rise of a Ninja.html | 2014-10-12 18:06 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Far Cry 3.html | 2014-10-12 18:04 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fist of the North Star Kens Rage.html | 2014-10-12 18:04 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dunamis 15.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Resident Evil Revelations.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Accel World Stage 01 Awakening of the Silver Wings.html | 2014-10-12 18:17 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Guitar Hero World Tour.html | 2014-10-12 18:04 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Far Cry Instincts Predator.html | 2014-10-12 18:04 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dragon Ball Raging Blast.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fallout 3.html | 2014-10-12 18:04 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Bomberman Act Zero.html | 2014-10-12 17:59 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sleeping Dogs.html | 2014-10-12 18:08 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Viva Piñata Party Animals.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Left 4 Dead Game of the Year Edition.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Turok.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Toy Story 3.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Fallout New Vegas.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Bodycount.html | 2014-10-12 17:59 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Far Cry 2.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Section 8.html | 2014-10-12 18:08 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Madagascar 3 The Video Game.html | 2014-10-12 18:13 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tetris Evolution.html | 2014-10-12 18:09 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_G-Force.html | 2014-10-12 18:12 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Idolm@ster 2.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Onechanbara Bikini Zombie Slayers.html | 2014-10-12 18:14 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sonic Free Riders.html | 2014-10-12 18:08 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Metal Gear Rising Revengeance.html | 2014-10-12 18:06 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Assassin's Creed II.html | 2014-10-12 18:17 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tropico 4.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Walking Dead.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_G-Force.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Joust.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_G-Force.html | 2014-10-12 18:04 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Persona 4 Arena.html | 2014-10-12 18:22 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_FIFA 12.html | 2014-10-12 18:04 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Bolt.html | 2014-10-12 17:59 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NCAA Football 13.html | 2014-10-12 18:06 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NBA 2K13.html | 2014-10-12 18:21 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Baja Edge of Control.html | 2014-10-12 17:59 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_FIFA 12.html | 2014-10-12 18:12 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Saw 2.html | 2014-10-12 18:08 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Buzz! The Ultimate Music Quiz.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_2011 The Legend of Zelda Skyward Sword Collector's Edition.html | 2014-10-12 18:11 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Assassin's Creed Rogue.html | 2014-10-12 17:59 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ben 10 Galactic Racing.html | 2014-10-12 18:17 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Golden Axe.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Grand Theft Auto Episodes from Liberty City.html | 2014-10-12 18:04 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Project Sylpheed.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_FIFA 11.html | 2014-10-12 18:04 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The History Channel Civil War – A Nation Divided.html | 2014-10-12 18:09 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Clash of the Titans.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_GT Pro Series.html | 2014-10-12 18:12 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_UFC Undisputed 2010.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tales of Xillia 2.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ridge Racer 7.html | 2014-10-12 18:22 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Perfect Dark Zero.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Oddworld Stranger's Wrath HD.html | 2014-10-12 18:22 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Bakugan Battle Brawlers.html | 2014-10-12 18:17 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Bionicle Heroes.html | 2014-10-12 18:11 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Red Dead Redemption Game of the Year Edition.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_FIFA Soccer 10.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rapala Pro Bass Fishing.html | 2014-10-12 18:22 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Angry Birds Trilogy.html | 2014-10-12 18:17 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NBA Ballers Chosen One.html | 2014-10-12 18:06 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Need for Speed Hot Pursuit.html | 2014-10-12 18:06 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Folklore.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Armored Core For Answer.html | 2014-10-12 18:17 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ninety-Nine Nights.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rumble Roses XX.html | 2014-10-12 18:08 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tetris.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Watchmen The End Is Nigh.html | 2014-10-12 18:25 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Arcana Heart 3.html | 2014-10-12 18:17 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NCAA Football 12.html | 2014-10-12 18:06 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Angry Birds Trilogy.html | 2014-10-12 18:11 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Aegis Wing.html | 2014-10-12 17:59 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Atelier Totori The Adventurer of Arland.html | 2014-10-12 18:17 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ridge Racer 6.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Project Gotham Racing 3.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Resident Evil Revelations.html | 2014-10-12 18:22 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Skylanders Giants.html | 2014-10-12 18:23 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NBA 2K14.html | 2014-10-12 18:06 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Deus Ex Human Revolution Director's Cut.html | 2014-10-12 18:03 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_UFC Personal Trainer The Ultimate Fitness System.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Captain America Super Soldier.html | 2014-10-12 18:00 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NFL Head Coach 09.html | 2014-10-12 18:06 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Gears of War Limited Collector's Edition.html | 2014-10-12 18:04 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dead or Alive 5.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Need for Speed Undercover.html | 2014-10-12 18:06 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_NBA 2K13.html | 2014-10-12 18:14 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_LittleBigPlanet Karting.html | 2014-10-12 18:20 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Super Fruit Fall.html | 2014-10-12 18:15 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Arcania Gothic 4.html | 2014-10-12 17:59 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Madden NFL 12.html | 2014-10-12 18:13 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cabela's Big Game Hunter 2012.html | 2014-10-12 18:11 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Supremacy MMA.html | 2014-10-12 18:09 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_MotoGP 10 11.html | 2014-10-12 18:21 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NCAA Football 14.html | 2014-10-12 18:21 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Accel World 02 Apex of Acceleration.html | 2014-10-12 18:17 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Kung Fu High Impact.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Super Mario Bros. Wii.html | 2014-10-12 18:15 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hohokum.html | 2014-10-12 18:20 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tomb Raider Underworld.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Worms 2 Armageddon.html | 2014-10-12 18:25 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Bolt.html | 2014-10-12 18:17 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Payday 2.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Sing 4 The Hits Edition.html | 2014-10-12 18:15 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Homefront.html | 2014-10-12 18:20 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Brink.html | 2014-10-12 18:00 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Big Bumpin'.html | 2014-10-12 17:59 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Eureka Seven AO Jungfrau no Hanabanatachi.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Resistance 3.html | 2014-10-12 18:22 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Cabela's Big Game Hunter 2012.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Spider-Man Edge of Time.html | 2014-10-12 18:15 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ultimate Shooting Collection.html | 2014-10-12 18:16 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_LEGO Marvel Super Heroes.html | 2014-10-12 18:20 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Terraria.html | 2014-10-12 18:09 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Prey.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Cross Edge.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Stoked.html | 2014-10-12 18:09 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rampart.html | 2014-10-12 18:22 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Plants vs. Zombies Garden Warfare.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Opoona.html | 2014-10-12 18:14 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cars 2.html | 2014-10-12 18:11 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Resident Evil Operation Raccoon City.html | 2014-10-12 18:22 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Skylanders SWAP Force.html | 2014-10-12 18:15 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Too Human.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Vanquish.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Batman Arkham Origins.html | 2014-10-12 18:17 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Need for Speed The Run.html | 2014-10-12 18:06 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ikaruga.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rayman Raving Rabbids.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Adventures of Tintin The Game.html | 2014-10-12 18:09 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Gears of War Judgment.html | 2014-10-12 18:04 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Call of Juarez Bound in Blood.html | 2014-10-12 18:00 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Monkey King The Legend Begins.html | 2014-10-12 18:16 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Warriors Orochi 2.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Call of Duty Black Ops.html | 2014-10-12 18:11 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Gunstringer.html | 2014-10-12 18:09 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mass Effect 3.html | 2014-10-12 18:21 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Skate 3.html | 2014-10-12 18:08 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ninja Gaiden 3.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Harms Way.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dynasty Warriors 7.html | 2014-10-12 18:03 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Splatterhouse.html | 2014-10-12 18:23 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Jet Set Radio.html | 2014-10-12 18:20 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_E.X. Troopers.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_DmC Devil May Cry.html | 2014-10-12 18:03 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Mario Party 9.html | 2014-10-12 18:13 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_DJ Hero.html | 2014-10-12 18:03 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Angry Birds Trilogy.html | 2014-10-12 17:59 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_de Blob 2.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tiger Woods PGA TOUR 12 The Masters.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Resident Evil 6.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ben 10 Galactic Racing.html | 2014-10-12 17:59 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Skate.html | 2014-10-12 18:08 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Adventures of Tintin The Game.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Guitar Hero Warriors of Rock.html | 2014-10-12 18:20 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Saints Row IV.html | 2014-10-12 18:23 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Cabela's Dangerous Hunts 2013.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Saints Row IV.html | 2014-10-12 18:08 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Godfather II.html | 2014-10-12 18:09 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Harry Potter and the Deathly Hallows Part 2.html | 2014-10-12 18:13 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_SpongeBob's Surf and Skate Roadtrip.html | 2014-10-12 18:09 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Deadliest Catch Alaskan Storm.html | 2014-10-12 18:02 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Magic The Gathering - Duels of the Planeswalkers 2012.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Prince of Persia The Forgotten Sands.html | 2014-10-12 18:22 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ben 10 Galactic Racing.html | 2014-10-12 18:11 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Bionic Commando Rearmed.html | 2014-10-12 18:17 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ice Age Continental Drift - Arctic Games.html | 2014-10-12 18:13 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Thief.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Prince of Persia The Forgotten Sands.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Kinectimals.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_DeathSpank Thongs of Virtue.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_DeathSpank Thongs of Virtue.html | 2014-10-12 18:02 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Saints Row The Third.html | 2014-10-12 18:23 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Captain Morgane and the Golden Turtle.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Bullet Witch.html | 2014-10-12 18:00 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Brothers a Tale of Two Sons.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Medal of Honor Warfighter.html | 2014-10-12 18:06 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Teenage Mutant Ninja Turtles.html | 2014-10-12 18:15 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Broken Sword Shadow of the Templars (The Director's Cut).html | 2014-10-12 18:11 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NHL 12.html | 2014-10-12 18:06 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Earth Defense Force 2017.html | 2014-10-12 18:03 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Raving Rabbids Alive & Kicking.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Madden NFL 13.html | 2014-10-12 18:20 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Avatar The Last Airbender – The Burning Earth.html | 2014-10-12 17:59 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Transformers Revenge of the Fallen.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Tangled.html | 2014-10-12 18:15 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dance Dance Revolution Universe.html | 2014-10-12 18:01 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Deathsmiles.html | 2014-10-12 18:02 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_MotoGP '06.html | 2014-10-12 18:06 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_LEGO Pirates of the Caribbean The Video Game.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Skate It.html | 2014-10-12 18:15 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_SimAnimals Africa.html | 2014-10-12 18:15 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tiger Woods PGA Tour 10.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Castlevania Lords of Shadow – Mirror of Fate HD.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Brothers a Tale of Two Sons.html | 2014-10-12 18:00 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Fight Night Champion.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tomb Raider Trilogy.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Mark of the Ninja.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_DreamWorks Super Star Kartz.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_DreamWorks Super Star Kartz.html | 2014-10-12 18:03 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_UDraw Studio Instant Artist.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Cabela's Outdoor Adventures.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Cabela's Outdoor Adventures.html | 2014-10-12 18:00 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Space Ace.html | 2014-10-12 18:23 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Outfit.html | 2014-10-12 18:09 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Velocity 2X.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Marvel Ultimate Alliance 2.html | 2014-10-12 18:21 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_DreamWorks Super Star Kartz.html | 2014-10-12 18:12 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Full Auto.html | 2014-10-12 18:04 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Darkstalkers Resurrection.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rise of the Argonauts.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Cabela's African Safari.html | 2014-10-12 18:00 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Kinect Disneyland Adventures.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Battle vs. Chess.html | 2014-10-12 18:17 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Lost Planet 3.html | 2014-10-12 18:20 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Operation Flashpoint Red River.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tekken 5 Dark Resurrection.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dead or Alive Xtreme 2.html | 2014-10-12 18:02 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Just Dance Summer Party.html | 2014-10-12 18:13 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Blur.html | 2014-10-12 18:17 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sonic Unleashed.html | 2014-10-12 18:08 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NCAA March Madness 07.html | 2014-10-12 18:06 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NBA 2K15.html | 2014-10-12 18:21 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Guitar Hero Metallica.html | 2014-10-12 18:13 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_WWE SmackDown vs. Raw 2007.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Phantom Breaker Extra.html | 2014-10-12 18:22 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Pirates of the Caribbean At World's End.html | 2014-10-12 18:22 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sonic & All-Stars Racing Transformed.html | 2014-10-12 18:08 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Tiger Woods PGA TOUR 12 The Masters.html | 2014-10-12 18:16 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Madagascar Escape 2 Africa.html | 2014-10-12 18:20 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ben 10 Omniverse.html | 2014-10-12 18:17 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ben 10 Omniverse.html | 2014-10-12 17:59 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The King of Fighters XII.html | 2014-10-12 18:09 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Jurassic The Hunted.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Madagascar Escape 2 Africa.html | 2014-10-12 18:13 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Silent Hill Shattered Memories.html | 2014-10-12 18:15 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Simpsons Game.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Simpsons Game.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NBA 2K12.html | 2014-10-12 18:21 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ben 10 Omniverse.html | 2014-10-12 18:11 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NBA 2K12.html | 2014-10-12 18:06 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Genji Days of the Blade.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Full Auto 2 Battlelines.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Pocket Bike Racer.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ghostbusters The Video Game.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Superstars V8 Racing - Next Challenge.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_BlazBlue Calamity Trigger.html | 2014-10-12 17:59 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sacred 2 Fallen Angel.html | 2014-10-12 18:23 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Incredible Hulk.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Skylanders Spyro's Adventure.html | 2014-10-12 18:15 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Incredible Hulk.html | 2014-10-12 18:09 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_DiRT 3.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Just Dance 4.html | 2014-10-12 18:20 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_LEGO The Hobbit.html | 2014-10-12 18:20 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Sonic Colors.html | 2014-10-12 18:15 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Star Trek.html | 2014-10-12 18:09 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Hole in the wall.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Autobahn Polizei.html | 2014-10-12 17:59 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Peppa Pig Fun and Games.html | 2014-10-12 18:14 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_FIFA Soccer 11.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Game Party In Motion.html | 2014-10-12 18:04 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Sonic the Hedgehog 4 Episode 1.html | 2014-10-12 18:15 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Earth Defense Force Insect Armageddon.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Who Wants to be a Millionaire 2nd Edition.html | 2014-10-12 18:16 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Sims 3.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Transformers Revenge of the Fallen.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Captain Morgane and the Golden Turtle.html | 2014-10-12 18:11 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Deca Sports Freedom.html | 2014-10-12 18:02 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Madden NFL 13.html | 2014-10-12 18:13 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dead or Alive 4.html | 2014-10-12 18:02 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Star Wars The Force Unleashed -- Ultimate Sith Edition.html | 2014-10-12 18:23 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Spider-Man Web of Shadows.html | 2014-10-12 18:23 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Battlefield Bad Company 2.html | 2014-10-12 18:17 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Otomedius Excellent.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Kung Fu Panda 2.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Battle of the Bands.html | 2014-10-12 18:11 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Scene It Bright Lights! Big Screen!.html | 2014-10-12 18:08 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Test Drive Unlimited 2.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Adventures of Tintin The Secret of the Unicorn.html | 2014-10-12 18:15 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Forza Motorsport 2.html | 2014-10-12 18:04 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Star Wars The Force Unleashed II Collector's Edition.html | 2014-10-12 18:09 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Kung Fu Panda 2.html | 2014-10-12 18:13 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Super Time Force.html | 2014-10-12 18:09 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Damnation.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Winter Stars.html | 2014-10-12 18:17 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Castlevania Lords of Shadow 2.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Smurfs 2.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sonic the Hedgehog.html | 2014-10-12 18:23 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Smurfs 2.html | 2014-10-12 18:16 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Pimp My Ride.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Kinect Adventures.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Chromehounds.html | 2014-10-12 18:01 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Disney Universe.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Wipeout 3.html | 2014-10-12 18:17 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_MotorStorm.html | 2014-10-12 18:21 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Deus Ex Human Revolution - Augmented Edition.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Lightning Returns Final Fantasy XIII.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Transformers War for Cybertron.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dead Island Game of the Year Edition.html | 2014-10-12 18:02 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_MotorStorm Apocalypse.html | 2014-10-12 18:21 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Saints Row.html | 2014-10-12 18:08 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Deus Ex Human Revolution - Augmented Edition.html | 2014-10-12 18:03 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_echochrome.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Avatar The Last Airbender – Into the Inferno.html | 2014-10-12 18:11 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Sims 3 Pets.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Conflict Denied Ops.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Magic the Gathering - Duels of the Planeswalkers 2013.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tenchu Z.html | 2014-10-12 18:09 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Culdcept Saga.html | 2014-10-12 18:01 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Fallout New Vegas Ultimate Edition.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NBA 2K13.html | 2014-10-12 18:06 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fable The Journey.html | 2014-10-12 18:04 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Fit & Fun.html | 2014-10-12 18:12 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NHL 2K6.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Lara Croft and the Guardian of Light.html | 2014-10-12 18:20 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Kane & Lynch 2 Dog Days.html | 2014-10-12 18:20 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Major League Baseball 2K7.html | 2014-10-12 18:21 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Superstars V8 Racing.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Smurfs 2.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_NASCAR The Game 2011.html | 2014-10-12 18:14 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rise of the Argonauts.html | 2014-10-12 18:22 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Lightning Returns Final Fantasy XIII.html | 2014-10-12 18:20 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SuperCar Challenge.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mass Effect 3 - N7 Collector's Edition.html | 2014-10-12 18:21 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Just Dance 2014.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Bass Pro Shops' The Strike.html | 2014-10-12 18:11 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Risen 2 Dark Waters.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Wolfenstein.html | 2014-10-12 18:25 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Crash Mind Over Mutant.html | 2014-10-12 18:12 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_DoDonPachi Resurrection Deluxe Edition.html | 2014-10-12 18:03 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Disney Universe.html | 2014-10-12 18:03 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_MLB 12 The Show.html | 2014-10-12 18:21 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Monster Hunter G.html | 2014-10-12 18:14 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_007 Legends.html | 2014-10-12 17:59 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Castlevania Lords of Shadow 2.html | 2014-10-12 18:00 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_LEGO Rock Band.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cars Race-O-Rama.html | 2014-10-12 18:11 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Major League Baseball 2K12.html | 2014-10-12 18:21 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Major League Baseball 2K11.html | 2014-10-12 18:21 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Major League Baseball 2K10.html | 2014-10-12 18:20 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Major League Baseball 2K11.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Major League Baseball 2K10.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Batman Arkham Origins.html | 2014-10-12 17:59 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Skylanders Giants.html | 2014-10-12 18:15 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Madden NFL 12.html | 2014-10-12 18:20 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Arcana Heart 3.html | 2014-10-12 17:59 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Call of Duty Modern Warfare 3.html | 2014-10-12 18:11 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Jurassic Park The Game.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Pro Evolution Soccer 2008.html | 2014-10-12 18:22 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Pro Evolution Soccer 2008.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Generator Rex Agent of Providence.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cabela's Dangerous Hunts 2011.html | 2014-10-12 18:11 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Need for Speed ProStreet.html | 2014-10-12 18:06 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Generator Rex Agent of Providence.html | 2014-10-12 18:04 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Need for Speed ProStreet.html | 2014-10-12 18:21 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rapala.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Crysis 2.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Karaoke Revolution Glee.html | 2014-10-12 18:13 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sacred 3.html | 2014-10-12 18:23 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Active Life Magical Carnival.html | 2014-10-12 18:11 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sacred 3.html | 2014-10-12 18:08 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Summer Stars 2012.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Marvel Avengers Battle for Earth.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hitman Absolution.html | 2014-10-12 18:20 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Pro Evolution Soccer 2011.html | 2014-10-12 18:22 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Pro Evolution Soccer 2011.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Yaiba Ninja Gaiden Z.html | 2014-10-12 18:25 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Flower.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Yaiba Ninja Gaiden Z.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Saints Row 2.html | 2014-10-12 18:23 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Medal of Honor.html | 2014-10-12 18:21 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sonic Adventure 2.html | 2014-10-12 18:08 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Pac-Man and the Ghostly Adventures.html | 2014-10-12 18:22 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Front Mission Evolved.html | 2014-10-12 18:19 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Pac-Man and the Ghostly Adventures.html | 2014-10-12 18:07 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Skylanders Spyro's Adventure.html | 2014-10-12 18:08 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NBA 2K11.html | 2014-10-12 18:21 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_MLB Front Office Manager.html | 2014-10-12 18:21 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_MLB Front Office Manager.html | 2014-10-12 18:06 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Two Worlds.html | 2014-10-12 18:10 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Brink.html | 2014-10-12 18:18 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ice Age Continental Drift - Arctic Games.html | 2014-10-12 18:05 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Top Spin 4.html | 2014-10-12 18:16 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Walking Dead.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Kirby's Dream Collection Special Edition.html | 2014-10-12 18:13 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Silent Hill Homecoming.html | 2014-10-12 18:23 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Pro Evolution Soccer 2012.html | 2014-10-12 18:22 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tom Clancy's Rainbow Six Vegas.html | 2014-10-12 18:24 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sonic the Hedgehog 2.html | 2014-10-12 18:23 | 42K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sonic the Hedgehog 2.html | 2014-10-12 18:08 | 42K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mega Man 10.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Pro Evolution Soccer 2012.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Cars 2.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Angry Birds Star Wars.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Grand Theft Auto V (Special Edition).html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Transformers Fall of Cybertron.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Sky Crawlers Innocent Aces.html | 2014-10-12 18:16 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Legend of Spyro Dawn of the Dragon.html | 2014-10-12 18:09 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Street Fighter X Tekken.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Bulletstorm.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Hasbro Family Game Night 4 The Game Show.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Legendary.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_LEGO Indiana Jones The Original Adventures.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_DuckTales Remastered.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Samurai Shodown Anthology.html | 2014-10-12 18:15 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_FIFA Street.html | 2014-10-12 18:04 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Monopoly Streets.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Cabela's Dangerous Hunts 2011.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dead Space 2.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dead Block.html | 2014-10-12 18:02 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dynasty Warriors 6 Empires.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Academy Of Champions Soccer.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Transformers Fall of Cybertron.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Pinball Hall of Fame The Gottlieb Collection.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Spider-Man Edge of Time.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dead Block.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Mega Man 10.html | 2014-10-12 18:06 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tokyo Jungle.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tiger Woods PGA Tour 12 The Masters.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_LEGO The lego movie videogame.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_LEGO The LEGO Movie Videogame.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tom Clancy's H.A.W.X.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_F1 Race Stars.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Happy Feet Two.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Winter Sports 2010 The Great Tournament.html | 2014-10-12 18:25 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Pro Evolution Soccer 2014.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Metal Gear Solid 4 Guns of the Patriots Limited Edition.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Age of Booty.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Scooby Doo! First Frights.html | 2014-10-12 18:15 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Mass Effect 3.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Aliens Colonial Marines.html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Super Mario RPG Legend of the Seven Stars.html | 2014-10-12 18:15 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Need for Speed Shift 2 Unleashed.html | 2014-10-12 18:06 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Happy Feet Two.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Orange Box.html | 2014-10-12 18:09 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Godfather II.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Bejeweled 3.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Walking Dead - Season 2.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Last Remnant.html | 2014-10-12 18:09 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Call of Juarez Cartel.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fallout New Vegas.html | 2014-10-12 18:04 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_I Am Alive.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Far Cry 3 Blood Dragon.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Happy Feet Two.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Air Conflicts Secret Wars.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Bejeweled 3.html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Far Cry 3 Blood Dragon.html | 2014-10-12 18:04 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Thor God of Thunder.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Eledees.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Gears of War Triple Pack.html | 2014-10-12 18:04 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_New Play Control! Pikmin 2.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_LEGO Star Wars The Complete Saga.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Race Driver Grid.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cave Story.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Our House Party!.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Lost Planet Extreme Condition.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Super Street Fighter II Turbo HD Remix.html | 2014-10-12 18:09 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dead Space.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Legend of Spyro Dawn of the Dragon.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Cave.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tekken Revolution.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Gran Turismo HD.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tony Hawk's Pro Skater HD.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Super Hang-On.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_4-in-1 Action PACK.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Super Hang-On.html | 2014-10-12 18:09 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Saint Seiya Brave Soldiers.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_BlackSite Area 51.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Toy Soldiers.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dragon's Dogma.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Blur.html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SSX.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Wolf Among Us.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Skylanders Giants.html | 2014-10-12 18:08 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Conduit 2.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Battlefield 3 Premium Edition.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Castlevania Lords of Shadow – Mirror of Fate HD.html | 2014-10-12 18:00 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_CSI Crime Scene Investigation Hard Evidence.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Bratz The Movie.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_James Cameron's Avatar The Game.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Darkness II.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hot Shots Golf Out of Bounds.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_CSI Crime Scene Investigation Deadly Intent.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Centipede Infestation.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NASCAR Unleashed.html | 2014-10-12 18:06 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Cars Race O Rama.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Up.html | 2014-10-12 18:16 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dragon Ball Revenge of King Piccolo.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Saw II Flesh & Blood.html | 2014-10-12 18:08 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Star Wars The Force Unleashed.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Oregon Trail.html | 2014-10-12 18:16 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Virtua Fighter 5.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Golden Compass.html | 2014-10-12 18:16 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Testament of Sherlock Holmes.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Revenge of Shinobi.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Beowulf The Game.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_NASCAR Unleashed.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_XCOM Enemy Unknown.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_de Blob 2.html | 2014-10-12 18:02 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Cabela's Dangerous Hunts 2013.html | 2014-10-12 18:00 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rock Band Track Pack Volume 2.html | 2014-10-12 18:08 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Elder Scrolls V Skyrim Legendary Edition.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Call of Duty 4 Modern Warfare.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_WRC FIA World Rally Championship.html | 2014-10-12 18:25 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_BlazBlue Continuum Shift.html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Toy Story 3.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sega Bass Fishing.html | 2014-10-12 18:08 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cabela's Hunting Expeditions.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Skylanders Spyro's Adventure.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_El Shaddai Ascension of the Metatron.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_CounterSpy.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Thor God of Thunder.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dungeon Siege III.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Madagascar Escape 2 Africa.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dead Space.html | 2014-10-12 18:02 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Iron Man.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Iron Man.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rise of the Guardians.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dishonored.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NCIS.html | 2014-10-12 18:06 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_FaceBreaker.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Elder Scrolls V Skyrim Legendary Edition.html | 2014-10-12 18:09 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Need for Speed Shift 2 Unleashed.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Castle of Illusion Remastered.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Trackmania Build to Race.html | 2014-10-12 18:16 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Iron Man.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_F.E.A.R. 3.html | 2014-10-12 18:04 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Air Conflicts Pacific Carriers.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Catherine.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tom Clancy's Ghost Recon Future Soldier.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Blast Works Build, Trade, Destroy.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dungeons & Dragons Chronicles of Mystara..html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dungeons & Dragons Chronicles of Mystara..html | 2014-10-12 18:03 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_LEGO Batman 3 Beyond Gotham.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tom Clancy's H.A.W.X. 2.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Bound by Flame.html | 2014-10-12 18:00 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Pro Evolution Soccer 2009.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Major League Baseball 2K9.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Pro Evolution Soccer 2009.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Steel Champions.html | 2014-10-12 18:09 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Pro Evolution Soccer 2010.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Sniper Elite.html | 2014-10-12 18:15 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Green Lantern Rise Of The Manhunters.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Disney Infinity.html | 2014-10-12 18:03 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Alice Madness Returns.html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Marvel Super Hero Squad The Infinity Gauntlet.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ultimate I Spy.html | 2014-10-12 18:16 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Pro Evolution Soccer 2009.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Major League Baseball 2K9.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Jelly Belly Ballistic Beans.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Knights Contract.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Hunted The Demon's Forge.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Crysis 3.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Conan.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Lara Croft and the Guardian of Light.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The First Templar.html | 2014-10-12 18:09 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The History Channel Civil War Secret Missions.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ratchet & Clank Future Quest For Booty.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Injustice Gods Among Us.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Split Second.html | 2014-10-12 18:09 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Men In Black Alien Crisis.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Age of Booty.html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Blades of Time.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Final Fantasy IV The After Years.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_F1 2012.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Jurassic Park The Game.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hotline Miami.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hell Yeah! Wrath of the Dead Rabbit.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Deus Ex Human Revolution Director's Cut.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rocksmith.html | 2014-10-12 18:08 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Littlest Pet Shop.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_F1 2011.html | 2014-10-12 18:04 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dragon Ball Raging Blast.html | 2014-10-12 18:03 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dynamite Headdy.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Risen.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Endless Ocean 2 Adventures of the Deep.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Trivial Pursuit.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Just Dance 4.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Battlefield Bad Company 2.html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NBA 2K11.html | 2014-10-12 18:06 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Guilty Gear XX Accent Core Plus.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Mass Effect [Platinum Hits].html | 2014-10-12 18:06 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Red Faction Armageddon.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Quantum Theory.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_NCAA Football 09.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ben 10 Ultimate Alien Cosmic Destruction.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Deadpool.html | 2014-10-12 18:02 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ben 10 Ultimate Alien Cosmic Destruction.html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Case Closed The Mirapolis Investigation.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_UDraw Dood's Big Adventure.html | 2014-10-12 18:16 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Phantom Brave We Meet Again.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Harry Potter and the Deathly Hallows Part 1.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_50 Cent Blood on the Sand.html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SBK-09 Superbike World Championship.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_50 Cent Blood on the Sand.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_We Cheer.html | 2014-10-12 18:16 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Create.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_2010 FIFA World Cup South Africa.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Cars 2.html | 2014-10-12 18:00 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Knights Contract.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sonic Adventure 2.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tom Clancy's Ghost Recon Advanced Warfighter.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Jillian Michaels Fitness Ultimatum 2010.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Wolf Among Us Episode 1 - Faith.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Blast Off.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Green Day Rock Band.html | 2014-10-12 18:04 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_F.E.A.R. 2 Project Origin.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Your Shape Featuring Jenny McCarthy.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Call of Juarez Bound in Blood.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NPPL Championship Paintball 2009.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Call of Duty World at War.html | 2014-10-12 18:00 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Split Second.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_FIFA Soccer 09.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_FIFA Soccer 08.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Deadpool.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_American McGee's Alice.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Hasbro Family Game Night 3.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Madden NFL 25.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Tetris Party.html | 2014-10-12 18:15 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cabela's Dangerous Hunts 2013.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Just Dance 2014.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_LEGO Marvel Super Heroes.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Nail'd.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Test Drive Unlimited 2.html | 2014-10-12 18:09 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Lollipop Chainsaw.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dokapon Kingdom.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Madden NFL 25.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Contra ReBirth.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Wanted Weapons of Fate.html | 2014-10-12 18:25 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_El Shaddai Ascension of the Metatron.html | 2014-10-12 18:03 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Naruto Shippuden Ultimate Ninja Storm Generations.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Metro Last Light.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Minecraft.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Wipeout 3.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_All-Pro Football 2K8.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Naruto Shippuden Ultimate Ninja Storm Generations.html | 2014-10-12 18:06 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Cabela's Survival Shadows of Katmai.html | 2014-10-12 18:00 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Super Street Fighter IV.html | 2014-10-12 18:09 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NASCAR The Game Inside Line.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Guilty Gear XX Accent Core.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cabela's African Adventures.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Madagascar 3 The Video Game.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Kingdoms of Amalur Reckoning.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sam & Max The Devil's Playhouse.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ratchet & Clank Collection.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rock Band 2.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Conan.html | 2014-10-12 18:01 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Motocross Madness.html | 2014-10-12 18:06 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Bastion.html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_SSX.html | 2014-10-12 18:09 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Resident Evil 6 Anthology.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Super Meat Boy.html | 2014-10-12 18:09 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Baconing.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Baconing.html | 2014-10-12 18:09 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_WWE SmackDown vs. Raw 2010.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Command & Conquer 3 Kane's Wrath.html | 2014-10-12 18:01 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rogue Trooper Quartz Zone Massacre.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Arcade Shooting Gallery.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Alice in Wonderland.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Apache Air Assault.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Apache Air Assault.html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hard Corps Uprising.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Lord of the Rings Aragorn's Quest.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sports Champions 2.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_X-Men Destiny.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Wipeout Create & Crash.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Puss In Boots.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_UDraw Pictionary.html | 2014-10-12 18:16 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Star Wars The Force Unleashed -- Ultimate Sith Edition.html | 2014-10-12 18:09 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Puss In Boots.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Pro Evolution Soccer 2014.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Family Guy Back to the Multiverse.html | 2014-10-12 18:04 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Testament of Sherlock Holmes.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Legend of Zelda Ocarina of Time.html | 2014-10-12 18:16 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Gradius ReBirth.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dora the Explorer Dora's Big Birthday Adventure.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NBA 2K7.html | 2014-10-12 18:06 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Family Guy Back to the Multiverse.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Perfect Dark.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Binary Domain.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Venetica.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NiGHTS into Dreams....html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_World of Goo.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Calling.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Crazy Taxi.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Crazy Taxi.html | 2014-10-12 18:01 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_XCOM Enemy Unknown.html | 2014-10-12 18:25 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Serious Sam Collection.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Crysis 3.html | 2014-10-12 18:01 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tiger Woods PGA Tour 14.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_GTA V.html | 2014-10-12 18:04 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rune Factory Tides of Destiny.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dream Pinball 3D.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Naughty Bear Gold Edition.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NBA Live 08.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_FIFA 13.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Prince of Persia (2008).html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_DiRT 3.html | 2014-10-12 18:03 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_PDC World Championship Darts Pro Tour.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Gummy Bears Minigolf.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Nier.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Kirby 64 The Crystal Shards.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Saints Row The Third The Full Package.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Misadventures of P.B. Winterbottom.html | 2014-10-12 18:09 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The King of Fighters XIII.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Guitar Hero Van Halen.html | 2014-10-12 18:04 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_NBA Live 08.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Madagascar 3 The Video Game.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Super Street Fighter IV.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tomb Raider Underworld.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Thor God of Thunder.html | 2014-10-12 18:16 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_BandFuse Rock Legends.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Resistance 2 Collector's Edition.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Zone of the Enders HD Collection.html | 2014-10-12 18:25 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dragon Age Origins - Ultimate Edition.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NCAA Basketball 10.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Two Worlds II.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Cabela's North American Adventure.html | 2014-10-12 18:00 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ace Combat Assault Horizon.html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Walking Dead Episode 5.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Iron Man 2.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Shank.html | 2014-10-12 18:08 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Iron Man 2.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Star Wars The Clone Wars – Republic Heroes.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Disney Sing It High School Musical 3 Senior Year.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dead Island Game of the Year Edition.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Disney Sing It High School Musical 3 Senior Year.html | 2014-10-12 18:03 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SCORE International Baja 1000.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_SCORE International Baja 1000.html | 2014-10-12 18:08 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_London 2012 - The Official Video Game of the Olympic Games.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Cabela's Hunting Expeditions.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NBA 2K10.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NBA 2K10.html | 2014-10-12 18:06 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Disney Sing It High School Musical 3 Senior Year.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_SCORE International Baja 1000.html | 2014-10-12 18:15 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Mortal Kombat Komplete Edition.html | 2014-10-12 18:06 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NHL 10.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Great Garfield Show The Threat of the Space Lasagna.html | 2014-10-12 18:16 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Top Spin 4.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_World of Zoo.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Spyborgs.html | 2014-10-12 18:15 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_American Mensa Academy.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Afro Samurai.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Karaoke Revolution Presents American Idol Encore.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tiger Woods PGA Tour 07.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_NBA 2K12.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_NBA 2K11.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Madden NFL 10.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Street Fighter X Tekken.html | 2014-10-12 18:09 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Need for Speed Hot Pursuit.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Call of Juarez.html | 2014-10-12 18:00 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Karaoke Revolution Presents American Idol Encore.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dark Void.html | 2014-10-12 18:02 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Bionic Commando (2009).html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Disgaea 3 Absence of Justice.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_SBK-09 Superbike World Championship.html | 2014-10-12 18:08 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Midway Arcade Origins.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_God of War Saga Collection.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Major League Baseball 2K8.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dragon Ball Z Ultimate Tenkaichi.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Major League Baseball 2K8.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_You Don't Know Jack.html | 2014-10-12 18:25 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Legend of Spyro Dawn of the Dragon.html | 2014-10-12 18:16 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ivy the Kiwi.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Littlest Pet Shop Friends.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dance Central 3.html | 2014-10-12 18:01 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Just Dance 3.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Race Driver Grid.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Might & Magic Clash of Heroes.html | 2014-10-12 18:06 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hasbro Family Game Night.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Hasbro Family Game Night.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Carcassonne.html | 2014-10-12 18:00 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Batman Arkham Asylum Game of the Year Edition.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_WWE SmackDown vs. Raw 2011.html | 2014-10-12 18:25 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Major League Baseball 2K8.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_You Don't Know Jack.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_George of the Jungle and the Search for the Secret.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Overlord II.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Crysis.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_F.E.A.R. 3.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Borderlands - Game of the Year Edition.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Aliens Colonial Marines.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Just Dance 4.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Mega Man 9.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Hail to the Chimp.html | 2014-10-12 18:04 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Transformers Ultimate Battle Edition.html | 2014-10-12 18:16 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_John Woo Presents Stranglehold.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Walking Dead Episode 4 -.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Castlevania Lords of Shadow Collection.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Castlevania Lords of Shadow Collection.html | 2014-10-12 18:00 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Medal of Honor Warfighter.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NBA 2K9.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Big Beach Sports 2.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Arcania The Complete Tale.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Black Eyed Peas Experience.html | 2014-10-12 18:15 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Test Drive Ferrari Legends.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_FIFA 13.html | 2014-10-12 18:04 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Space Channel 5 Part 2.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mortal Kombat Komplete Edition.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Space Channel 5 Part 2.html | 2014-10-12 18:08 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_MLB 11 The Show.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Days of Thunder NASCAR Edition.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sega Superstars Tennis.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Blazing Angels 2 Secret Missions of WWII.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NBA 2K14.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NASCAR Unleashed.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Nike+ Kinect Training.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Karaoke Revolution Glee Volume 2.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Crazy Machines.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Crysis 2 Limited Edition.html | 2014-10-12 18:01 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tom Clancy's EndWar.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Legend of the Guardians The Owls of Ga'Hoole.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Legend of the Guardians The Owls of Ga'Hoole.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_James Bond 007 Blood Stone.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Akai Katana.html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Tony Hawk Shred Stand-Alone Software.html | 2014-10-12 18:16 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NBA Baller Beats.html | 2014-10-12 18:06 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Blitz The League II.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Backyard Football.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Blitz The League II.html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Shank.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Legend of Zelda.html | 2014-10-12 18:16 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Legend of the Guardians The Owls of Ga'Hoole.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NFL Blitz.html | 2014-10-12 18:06 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Alan Wake's American Nightmare.html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dead or Alive 5.html | 2014-10-12 18:02 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Heavy Rain.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_F1 Race Stars.html | 2014-10-12 18:04 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_From Dust.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Night at the Museum Battle of the Smithsonian.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Penny Arcade Adventures Episode Two.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Penny Arcade Adventures Episode One.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Penny Arcade Adventures Episode Two.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Penny Arcade Adventures Episode One.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Target Terror.html | 2014-10-12 18:15 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dead Island.html | 2014-10-12 18:02 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_2010 FIFA World Cup South Africa.html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_IL-2 Sturmovik Birds of Prey.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Virtua Fighter 5 Final Showdown.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mini Ninjas.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rage.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Guacamelee!.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_American McGee's Alice.html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Anarchy Reigns.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Record of Agarest War Zero Limited Edition.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Disney The Princess and the Frog.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Fight Night Round 3.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Reel Fishing Angler's Dream.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NHL 14.html | 2014-10-12 18:06 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Where the Wild Things Are.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Monaco What's Yours Is Mine.html | 2014-10-12 18:06 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Marvel Super Hero Squad Comic Combat.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Quantum Conundrum.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Orange Box.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Sherlock Holmes The Mystery of the Mummy.html | 2014-10-12 18:15 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ridge Racer Unbounded.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Jillian Michaels Fitness Ultimatum 2011.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ridge Racer Unbounded.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_DJ Hero.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dance Central.html | 2014-10-12 18:01 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Skate 2.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Who Wants to be a Millionaire.html | 2014-10-12 18:16 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Beyond Good & Evil HD.html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ratchet & Clank Q-Force.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_DJ Hero.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NCIS.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Birds of Steel.html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Retro City Rampage.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ratchet & Clank All 4 One.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Retro City Rampage.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rio.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Harry Potter and the Deathly Hallows Part 2.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_FlatOut.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_WRC 3 World Rally Championship.html | 2014-10-12 18:25 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Destroy All Humans! Path Of The Furon.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_James Bond 007 Blood Stone.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Two Worlds II.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sonic & SEGA All-Stars Racing.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rock Band.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Teenage Mutant Ninja Turtles Turtles in Time Reshelled.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Fist of the North Star Ken's Rage 2.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Brave The Video Game.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fist of the North Star Ken's Rage 2.html | 2014-10-12 18:04 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Last Rebellion.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Eye Pet and Friends.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_NBA Live 09.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Kirby's Adventure.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Retro City Rampage.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NCAA Football 09.html | 2014-10-12 18:06 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Shrek Forever After.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Shrek Forever After.html | 2014-10-12 18:08 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Men In Black Alien Crisis.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Atelier Rorona Plus The Alchemist of Arland.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Back to the Future The Game.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NCAA Football 09.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Elder Scrolls IV Oblivion -- Game of the Year Edition.html | 2014-10-12 18:09 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Kane & Lynch Dead Men.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Petz Dogz 2.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dead to Rights Retribution.html | 2014-10-12 18:02 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Streets of Rage 2.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Blade Kitten.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Kid Icarus.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Brave The Video Game.html | 2014-10-12 18:00 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_After Burner Climax.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Last Story Limited Edition.html | 2014-10-12 18:16 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dynasty Warriors Strikeforce.html | 2014-10-12 18:03 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Costume Quest.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Shrek Forever After.html | 2014-10-12 18:15 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sega Bass Fishing.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Gran Turismo 5 XL Edition.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_New Carnival Games.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rock Band Metal Track Pack.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ar Nosurge Ode to an Unborn Star.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dishonored.html | 2014-10-12 18:03 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Record of Agarest War.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Amazing Spider-Man 2.html | 2014-10-12 18:09 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Record of Agarest War.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tiger Woods PGA Tour 13.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mayhem.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tiger Woods PGA Tour 13.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Fuel.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tales of Vesperia Special Edition.html | 2014-10-12 18:09 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Fatal Frame II Crimson Butterfly.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_F1 2011.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Fantastic Four Rise of the Silver Surfer.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Uno.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_AC DC Live Rock Band Track Pack.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Battle of Giants Dinosaurs Strike.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Borderlands 2 Game of the Year.html | 2014-10-12 18:00 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rise of the Guardians.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sengoku Hime 3 Tenka o Kirisaku Hikari to Kage.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_MX vs. ATV Reflex.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Combat Wings The Great Battles of WWII.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_MX vs. ATV Reflex.html | 2014-10-12 18:06 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Combat Wings The Great Battles of WWII.html | 2014-10-12 18:01 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Carnival Games Monkey See, Monkey Do.html | 2014-10-12 18:00 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_LIMBO.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Thrillville Off The Rails.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Lollipop Chainsaw.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_MUD FIM Motocross World Championship.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_MUD FIM Motocross World Championship.html | 2014-10-12 18:06 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Warhammer 40,000 Space Marine.html | 2014-10-12 18:25 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Puzzle Chronicles.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Puzzle Chronicles.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Chronicles of Narnia Prince Caspian.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_PAYDAY 2.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dance Dance Revolution II.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Chronicles of Narnia Prince Caspian.html | 2014-10-12 18:09 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SOCOM 4 U.S. Navy SEALs.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Forza Horizon 2.html | 2014-10-12 18:04 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Asura's Wrath.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Command & Conquer Red Alert 3.html | 2014-10-12 18:01 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_WWE Legends of Wrestlemania.html | 2014-10-12 18:25 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ju-on The Grudge.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Naruto Ultimate Ninja Storm.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_WWE Legends of Wrestlemania.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Chronicles of Narnia Prince Caspian.html | 2014-10-12 18:15 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Sims 3 Pets.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Madden NFL 11.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Hot Wheels Battle Force 5.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Robotron 2084.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Risen 3 Titan Lords.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Risen 3 Titan Lords.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sniper Ghost Warrior.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Grand Theft Auto Episodes from Liberty City.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rock Band Track Pack Classic Rock.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rock Band Track Pack Classic Rock.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Marvel vs. Capcom Origins.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Marvel vs. Capcom Origins.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Vancouver 2010.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Sea Monsters A Prehistoric Adventure.html | 2014-10-12 18:15 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Monkey Island Special Edition Collection.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Anarchy Reigns.html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rock Band Track Pack Classic Rock.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dynasty Warriors Strikeforce.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Braid.html | 2014-10-12 18:00 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Adventures of Sherlock Holmes The Silver Earring.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ninja Gaiden 3 Razor's Edge.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_ToeJam & Earl.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NBA Live 09.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Gem Smashers.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NBA Live 09.html | 2014-10-12 18:06 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Garfield Gets Real.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Spec Ops The Line.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rock Revolution.html | 2014-10-12 18:08 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Walking Dead Survival Instinct.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Williams Pinball Classics.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Disney Princess My Fairytale Adventure.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Create.html | 2014-10-12 18:01 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NPPL Championship Paintball 2009.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dynasty Warriors 7.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ultimate Band.html | 2014-10-12 18:16 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Data East Arcade Classics.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Looney Tunes Acme Arsenal.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SBK Superbike World Championship.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_NPPL Championship Paintball 2009.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_SBK Superbike World Championship.html | 2014-10-12 18:08 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Basketball Hall-of-Fame Ultimate Hoops Challenge.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Band Hero.html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ferrari Challenge Trofeo Pirelli.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Witcher 2 Assassins of Kings - Enhanced Edition.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Saboteur.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Combat Wings The Great Battles of WWII.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Trials Evolution.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_JoJo's Bizarre Adventure All Star Battle.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_History Legends of War Patton.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Cabela's Survival Shadows of Katmai.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Yakuza 4.html | 2014-10-12 18:25 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ferrari Challenge Trofeo Pirelli.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_UFC Undisputed 2010.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Trivial Pursuit.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Retro Grade.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Skullgirls.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Stuntman Ignition.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_PixelJunk Shooter.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Pac-Man Championship Edition DX.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_London 2012 - The Official Video Game of the Olympic Games.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tom Clancy's EndWar.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Another Code R - A Journey into Lost Memories.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Boogie Superstar.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rock Band Track Pack Volume 2.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dishonored Game of the Year.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Go Vacation.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Zumba Fitness Core.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Crazy Mini Golf 2.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tiger Woods PGA Tour 11.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Silent Hill HD Collection.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Buzz! Quiz TV Bundle.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Planet 51.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Planet 51.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Earth Defense Force 2025.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dark Void.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Earth Defense Force 2025.html | 2014-10-12 18:03 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Charlie Murder.html | 2014-10-12 18:01 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Endless Ocean Blue World.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Megamind Ultimate Showdown.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Record of Agarest War 2.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sonic the Hedgehog 4 Episode 1.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rock Band Track Pack Volume 2.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sonic the Hedgehog 4 Episode 1.html | 2014-10-12 18:08 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ni Hao Kai-lan Super Game Day.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Disaster Day of Crisis.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Walking Dead Survival Instinct.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SAW.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dirt Showdown.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_ABBA You Can Dance.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Double Fine Happy Action Theater.html | 2014-10-12 18:03 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rock Band Country Track Pack.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rock Band Country Track Pack.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NCAA Football 07.html | 2014-10-12 18:06 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Planet 51.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Deception IV Blood Ties.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Record of Agarest War Zero Limited Edition.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tony Hawk Shred Stand-Alone Software.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dragon Ball Z for Kinect.html | 2014-10-12 18:03 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Active Life Explorer.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Transformers Dark of the Moon.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rock Band Country Track Pack.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dead Space 2 Limited Edition.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ascend New Gods.html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Scene It Lights, Camera, Action.html | 2014-10-12 18:08 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Deus Ex Human Revolution.html | 2014-10-12 18:03 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Crazy Machines Elements.html | 2014-10-12 18:01 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Painkiller Hell and Damnation.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Fist of the North Star Ken's Rage.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Painkiller Hell and Damnation.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Hell Yeah! Wrath of the Dead Rabbit.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Crazy Machines Elements.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Fortune Street.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Disney Infinity.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Darkness II.html | 2014-10-12 18:09 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Wheelman.html | 2014-10-12 18:25 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Castlevania Symphony of the Night.html | 2014-10-12 18:01 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_WWE SmackDown vs. Raw 2010.html | 2014-10-12 18:25 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Karaoke Revolution Glee Volume 3.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Grand Theft Auto IV (Platinum Hits).html | 2014-10-12 18:04 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Red Dead Redemption Undead Nightmare.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Droplitz.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Droplitz.html | 2014-10-12 18:03 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ragnarok Odyssey ACE.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NCAA Football 12.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_From Dust.html | 2014-10-12 18:04 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Unreal Tournament 3.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Crysis.html | 2014-10-12 18:01 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Karaoke Revolution Presents American Idol Encore 2.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Drawn to Life the Next Chapter.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Arctic Tale.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tron Evolution.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Karaoke Revolution Presents American Idol Encore 2.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_L.A. Noire.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Marvel Super Hero Squad The Infinity Gauntlet.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_LIMBO.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_L.A. Noire.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Deadliest Catch Sea of Chaos.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Up.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Enchanted Arms.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Of Orcs and Men.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NCAA Basketball 09.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Wii Play Motion.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_MindJack.html | 2014-10-12 18:06 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Transformers Prime The Game.html | 2014-10-12 18:16 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Karaoke Revolution Presents American Idol Encore 2.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Lightning ReturnsFinal Fantasy XIII Collector's Edition.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Baroque.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Madden NFL 10.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Go, Diego, Go! Great Dinosaur Rescue.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Omerta City of Gangsters.html | 2014-10-12 18:07 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Capcom Digital Collection.html | 2014-10-12 18:00 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dead Space Extraction.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Inversion.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dynasty Warriors Gundam 2.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Alien Breed.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dynasty Warriors Gundam 2.html | 2014-10-12 18:03 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Record of Agarest War 2 Limited Edition.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Price Is Right.html | 2014-10-12 18:16 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Gran Turismo 6.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Bakugan Defenders Of The Core.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Chaotic Shadow Warriors.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Minute to Win It.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Zuma's Revenge.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sharin no Kuni, Himawari no Shoujo.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_How to Train Your Dragon.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hot Wheels World's Best Drive.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sharin no Kuni, Himawari no Shoujo.html | 2014-10-12 18:08 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NBA Live 10.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Spartacus Legends.html | 2014-10-12 18:08 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_LittleBigPlanet 2.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_2K Sports Combo Pack MLB 2K12 NBA 2K12.html | 2014-10-12 17:59 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_10 Minute Solution.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Monkey Island 2 Special Edition LeChuck's Revenge.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Monkey Island 2 Special Edition LeChuck's Revenge.html | 2014-10-12 18:06 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rhythm Heaven Fever.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Chaotic Shadow Warriors.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Hitman HD Trilogy.html | 2014-10-12 18:05 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mass Effect Trilogy.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Shaun White Skateboarding.html | 2014-10-12 18:23 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Shaun White Skateboarding.html | 2014-10-12 18:08 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Venetica.html | 2014-10-12 18:25 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_How to Train Your Dragon.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_flOw.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dance Dance Revolution.html | 2014-10-12 18:18 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dance Dance Revolution.html | 2014-10-12 18:01 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tiger Woods PGA Tour 14.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tales of Xillia.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tom Clancy's Rainbow 6 Patriots.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Supreme Commander 2.html | 2014-10-12 18:09 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Metal Gear Solid The Legacy Collection.html | 2014-10-12 18:21 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dance Dance Revolution.html | 2014-10-12 18:12 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Shaun White Skateboarding.html | 2014-10-12 18:15 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Bleach Soul Resurreccion.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Agarest Generations Of War.html | 2014-10-12 18:17 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Cursed Crusade.html | 2014-10-12 18:24 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_LEGO Harry Potter Years 1-4.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Kidz Sports Crazy Golf.html | 2014-10-12 18:13 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Virtua Tennis 2009.html | 2014-10-12 18:10 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Planes.html | 2014-10-12 18:14 | 41K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Babysitting Mama.html | 2014-10-12 18:11 | 41K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Defense Grid The Awakening.html | 2014-10-12 18:02 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_PixelJunk Eden.html | 2014-10-12 18:22 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Fairytale Fights.html | 2014-10-12 18:19 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Jurassic The Hunted.html | 2014-10-12 18:20 | 41K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Cars Mater-National Championship.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Game of Thrones.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Gunstar Heroes.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Game of Thrones.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tomb Raider Anniversary.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Jurassic The Hunted.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sherlock Holmes vs. Jack the Ripper.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Geometry Wars Retro Evolved.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_FIFA Soccer 13.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Journey.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Line Rider 2 Unbound.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sonic's Ultimate Genesis Collection.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rock of the Dead.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Left 4 Dead.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_TNA Impact.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Godfather The Don's Edition.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Naruto Shippuden Clash of Ninja Revolution 3.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_London Taxi Rushour.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_History Legends of War Patton.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Shimano Xtreme Fishing.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Zen Pinball 2.html | 2014-10-12 18:25 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Schlag den Raab - Das 2. Spiel.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hyperdimension Neptunia Victory Limited Edition.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Destroy All Humans! Path of the Furon.html | 2014-10-12 18:03 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Bomberman Live.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_CSI Fatal Conspiracy.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Schlag den Raab - Das 2. Spiel.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_CSI Fatal Conspiracy.html | 2014-10-12 18:01 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Saw II Flesh & Blood.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Mario Kart 64.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_BIT.TRIP RUNNER.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sly Cooper And The Thievius Raccoonus.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_UFC 2009 Undisputed.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_MLB 13 The Show.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_History Channel - Battle for the Pacific.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Champion Jockey G1 Jockey & Gallop Racer.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_JumpStart Get Moving Family Fitness Sports Edition featuring Brooke Burke.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_CSI Fatal Conspiracy.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Top Spin 4.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hasbro Family Game Night 4 The Game Show.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Hasbro Family Game Night 4 The Game Show.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fable III Limited Collector's Edition.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_XBLAZE Code Embryo.html | 2014-10-12 18:25 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Band Hero.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fallout 3 Game Add-On Pack The Pitt and Operation Anchorage.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Gunslingers.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NCAA Football 10.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_PlayStation All-Stars Battle Royale.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Pictionary Ultimate Edition.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Cabela's Adventure Camp.html | 2014-10-12 18:00 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Way of the Samurai 3.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Spelunky.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Madagascar Kartz.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Champion Jockey G1 Jockey & Gallop Racer.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Madagascar Kartz.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Contra.html | 2014-10-12 18:01 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NASCAR 09.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Uncharted 3 Drake's Deception - Game of the Year Edition.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Lost Planet 2.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_MySims SkyHeroes.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Injustice Gods Among Us Ultimate Edition.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Walking Dead 400 Days.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_MySims SkyHeroes.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Feeding Frenzy.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Lost Planet 2.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Jimmie Johnson's Anything with an Engine.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Brave The Video Game.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Disney Sing It.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Disney Sing It.html | 2014-10-12 18:03 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Far Cry Classic.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Castlevania The Adventure ReBirth.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Madagascar Kartz.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Peggle.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_NCIS.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Haze.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Thrillville Off the Rails.html | 2014-10-12 18:16 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Kingdom Hearts HD 2.5 ReMIX.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_MySims SkyHeroes.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Devil May Cry HD Collection.html | 2014-10-12 18:03 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Grand Theft Auto IV The Complete Edition.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rock Revolution.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Jimmie Johnson's Anything with an Engine.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Blades of Time.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Kung Fu Panda 2.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Just Dance Kids 2.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Disney Sing It.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Santa Claus is Comin' to Town.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Alien Hominid HD.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Guinness World Records the Videogame.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fallout 3 Game Add-On Pack Broken Steel and Point Lookout.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rock Revolution.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Guitar Hero 5.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Lego Rock Band.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dungeon Defenders.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_My Zoo.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dungeon Defenders.html | 2014-10-12 18:03 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hitman HD Trilogy.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Paper Mario.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Need for Speed Shift.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Family Party 90 Great Games Party Pack.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Exerbeat Gym Class Workout.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Doctor Fizzwizzles's Animal Rescue.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sonic the Hedgehog 4 Episode 2.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sonic the Hedgehog 4 Episode 2.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Kinect Sports Ultimate Collection.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Kane & Lynch 2 Dog Days.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Halo 3 Legendary Edition.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Marvel Super Hero Squad Comic Combat.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Guitar Hero 5.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Alvin and the Chipmunks Chipwrecked.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Spy Games Elevator Mission.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Scene It Bright Lights! Big Screen!.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sega Rally Revo.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Midnight Club Los Angeles -- Complete Edition.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sega Rally Revo.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Medal of Honor.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Bulletstorm.html | 2014-10-12 18:00 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_DJ Hero 2.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Split Second Velocity.html | 2014-10-12 18:09 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ninja Gaiden 3 Collector's Edition.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Final Fantasy XIV A Realm Reborn.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_UFC 2009 Undisputed.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_JAWS Ultimate Predator.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Marvel Super Hero Squad Comic Combat.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Smash Court Tennis 3.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Champion Jockey G1 Jockey & Gallop Racer.html | 2014-10-12 18:01 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Lord of the Rings The War in the North.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_America's Next Top Model.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Lord of the Rings The War in the North.html | 2014-10-12 18:09 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Code Lyoko Quest for Infinity.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Scene It Bright Lights! Big Screen!.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Heavy Rain Director's Cut.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Juiced 2 Hot Import Nights.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Juiced 2 Hot Import Nights.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_WarioWare D.I.Y. Showcase.html | 2014-10-12 18:16 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_DJ Hero 2.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Lost Via Domus.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_BIT.TRIP Presents Runner 2 Future Legend of Rhythm Alien.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Blazblue Continuum Shift Extend.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Lost Via Domus.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_World Championship Athletics.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ashes Cricket 2009.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Kinect Nat Geo TV America the Wild.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rock of the Dead.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Superstars V8 Racing - Next Challenge.html | 2014-10-12 18:09 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Final Fantasy XIII-2 Collector's Edition.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Disgaea D2 A Brighter Darkness.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ashes Cricket 2009.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Monster Mayhem Build and Battle.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Jikkyou Powerful Pro Yakyuu 2012 Ketteiban.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Paws & Claws Pet Resort.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Escape The Museum.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Sled Shred featuring the Jamaican Bobsled Team.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tales of Vesperia.html | 2014-10-12 18:09 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Surf's Up.html | 2014-10-12 18:09 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Guitar Hero Van Halen.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Doom 3 BFG Edition.html | 2014-10-12 18:03 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Disgaea 4 A Promise Unforgotten.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Midway Arcade Origins.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tomb Raider The Final Hours Edition.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tomb Raider The Final Hours Edition.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Grand Theft Auto IV The Complete Edition.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Fritz Chess.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Wipeout Create & Crash.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Story Hour Adventures.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Closure.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fast & Furious Showdown.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Adventure Time Explore The Dungeon Because I Don't Know.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Metro Last Light - Limited Edition.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Metro Last Light - Limited Edition.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Operation Flashpoint Dragon Rising.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NHL 2K10.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Operation Flashpoint Dragon Rising.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Fracture.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SBK X Superbike World Championship.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_SBK X Superbike World Championship.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Super Puzzle Fighter II Turbo HD Remix.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sine Mora.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NBA 2K7.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sniper Elite V2.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Active Life Extreme Challenge.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sniper Elite V2.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Kidz Bop Dance Party!.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Port Royale 3 Pirates & Merchants.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NHL 2K7.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Spectrobes Origins.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Sing It - Pop Hits.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Port Royale 3 Pirates & Merchants.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Halo Reach Legendary Edition.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_NHL 2K10.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_ToeJam & Earl in Panic on Funkotron.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Project CARS.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Project CARS.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NHL 2K9.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Call of Juarez Gunslinger.html | 2014-10-12 18:00 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Army of Two The Devil's Cartel.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Silent Hill Homecoming.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Battlefield 1943.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Grand Slam Tennis 2.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Iron Sky Invasion.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Iron Sky Invasion.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_NHL 2K9.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Fritz Chess.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Air Conflicts Pacific Carriers.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sam & Max Beyond Time and Space.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rock Band Country Track Pack 2.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sam & Max Beyond Time and Space.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rock Band Country Track Pack 2.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dynasty Warriors Gundam 3.html | 2014-10-12 18:03 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Walking Dead Episode 4 Around Every Corner.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Castle Crashers.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_NiGHTS Journey of Dreams.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dynasty Warriors Gundam 3.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Blazblue Continuum Shift Extend.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Order Up!.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sonic & SEGA All-Stars Racing with Banjo-Kazooie.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_BIT. TRIP Presents Runner 2 Future Legend of Rhythm Alien.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Kinectimals Now with Bears!.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rock Band Country Track Pack 2.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Toy Soldiers Cold War.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_GoldenEye 007 Reloaded.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rocketbirds Hardboiled Chicken.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Birds of Steel.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NASCAR The Game Inside Line.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Alvin and the Chipmunks Chipwrecked.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ski Doo Snowmobile Challenge.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ski Doo Snowmobile Challenge.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Mortal Kombat vs. DC Universe.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Deadliest Catch Sea of Chaos.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Deadliest Catch Sea of Chaos.html | 2014-10-12 18:02 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Operation Flashpoint Red River.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NHL 12.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Doctor Who The Eternity Clock.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Jane's Advanced Strike Fighters.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Jane's Advanced Strike Fighters.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Singularity.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sonic CD.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NHL 08.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Atelier Ayesha The Alchemist of Dusk.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sonic CD.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Let's Dance with Mel B.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_IL-2 Sturmovik Birds of Prey.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ski Doo Snowmobile Challenge.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rango.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mars War Logs.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Turning Point Fall of Liberty.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ghostbusters Sanctum of Slime.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Turning Point Fall of Liberty.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ghostbusters Sanctum of Slime.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Luxor 2.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Pinball Arcade.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dragon Age Origins - Awakening.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dragon Age Origins - Awakening.html | 2014-10-12 18:03 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Walking Dead Episode 2 Starved for Help.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tiger Woods PGA Tour 10.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rango.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Shank 2.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SBK 2011 Superbike World Championship.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_SBK 2011 Superbike World Championship.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ben 10 Alien Force Vilgax Attacks.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fuzion Frenzy 2.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dragon Ball Z Budokai HD Collection.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Skylanders Giants Portal Owners Pack.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Oddworld Munch's Oddysee HD.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Vancouver 2010.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Skylanders Giants Portal Owners Pack.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Mass Effect 2 Collector's Edition.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Linger in Shadows.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Smarty Pants.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Devil May Cry HD Collection.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Walking Dead Episode 3 Long Road Ahead.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Luxor Pharaoh's Challenge.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Family Fun Football.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Atelier Escha & Logy Alchemist of Dusk Sky.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Military Madness Nectaris.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hasbro Family Game Night 3.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Zumba Fitness World Party.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_National Geographic Challenge!.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Military Madness Nectaris.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Hasbro Family Game Night 3.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Prison Break The Conspiracy.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Where the Wild Things Are.html | 2014-10-12 18:16 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Shadow Complex.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Prison Break The Conspiracy.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Final Fantasy Fables Chocobo's Dungeon.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_L.A. Noire The Complete Edition.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Puss In Boots.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Divinity II - The Dragon Knight Saga.html | 2014-10-12 18:03 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_UDraw Studio.html | 2014-10-12 18:16 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_World of Tanks Xbox 360 Edition.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Braid.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Warface.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Medal of Honor Warfighter - Limited Edition.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Marvel Ultimate Alliance Forza 2 Combo Pack.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Space Chimps.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tom Clancy's Rainbow 6 Patriots.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Military Madness Nectaris.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Boom Boom Rocket.html | 2014-10-12 18:00 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Soldier of Fortune Payback.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Persona 4 Arena Ultimax.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Price Is Right Decades.html | 2014-10-12 18:16 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Greg Hastings Paintball 2.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ultimate Marvel Vs. Capcom 3.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Greg Hastings Paintball 2.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ultimate Marvel Vs. Capcom 3.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Deer Drive Legends.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Crash Car Racer.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Kinect Sesame Street TV.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Jikkyou Powerful Pro Yakyuu 2012.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Borderlands 2 Add-On Content Pack.html | 2014-10-12 18:00 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Deadliest Warrior Ancient Combat.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Deadliest Warrior Ancient Combat.html | 2014-10-12 18:02 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Naughty Bear Panic in Paradise.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Child of Eden.html | 2014-10-12 18:01 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Zumba Fitness 2.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NCAA Basketball 10.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Zumba Fitness Core.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Lucha Libre AAA Heroes del Ring.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Crysis 2.html | 2014-10-12 18:01 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Lucha Libre AAA Heroes del Ring.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_El Chavo Kart.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Greg Hastings Paintball 2.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Pure.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rudolph The Red-Nosed Reindeer.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tekken 6.html | 2014-10-12 18:09 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ninja Gaiden 3 Razor's Edge.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_TNA iMPACT!.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dungeon Hunter Alliance.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Walking Dead Episode 5 No Time Left.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Naughty Bear Panic in Paradise.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Guitar Hero Smash Hits.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dirt 3 Complete Edition.html | 2014-10-12 18:03 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Resident Evil 4 HD.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NCAA March Madness 08.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_uDraw GameTablet with uDraw Studio.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_uDraw GameTablet with uDraw Studio.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fez.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Resonance of Fate.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Bladestorm The Hundred Years' War.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NCAA March Madness 08.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Fast & Furious Showdown.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Guitar Hero Smash Hits.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Halo Wars Limited Edition.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Bionic Commando Rearmed.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Assassin's Creed Freedom Cry.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Walking Dead Episode 1 A New Day.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dead Rising 2 Off The Record.html | 2014-10-12 18:02 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Faery Legends of Avalon.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Kirbys Dream Collection.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Faery Legends of Avalon.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Supremacy MMA.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Nickelodeon Fit.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Medal of Honor Airborne.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dynasty Warriors 7 Empires.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Everyone Sing.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Wanted Weapons of Fate.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NASCAR The Game 2011.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Let's Dance with Mel B.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Shadows of the Damned.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sniper Ghost Warrior 2.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sniper Ghost Warrior 2.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Trials HD.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Battlestations Pacific.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Neighborhood Games.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_DarkStar One Broken Alliance.html | 2014-10-12 18:02 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Playground.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tropico 4 Gold Edition.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Marble Blast Ultra.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Battleblock Theater.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_3D Dot Game Heroes.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Luxor 3.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Leisure Suit Larry Box Office Bust.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rec Room Games.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Club.html | 2014-10-12 18:09 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Pictionary Ultimate Edition.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Switchball.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Get Up Family Sports.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Kinect Rush A Disney Pixar Adventure.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dead or Alive 5 Ultimate.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Blacklight Tango Down.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Blacklight Tango Down.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Onslaught.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Enemy Territory Quake Wars.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Pirates vs Ninjas Dodgeball.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Myth Makers Trixie in Toyland.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Castle of Shikigami III.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Infernal.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Doctor Who Return to Earth.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rambo The Video Game.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rambo The Video Game.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_N3II Ninety-Nine Nights.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NCAA Basketball 09.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Everyday Shooter.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Quantum Theory.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Yakuza 5.html | 2014-10-12 18:25 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Kylie Sing & Dance.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Green Day Rock Band.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sniper Ghost Warrior.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Shellshock 2 Blood Trails.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Midnight Club Los Angeles -- Complete Edition.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_SNK Arcade Classics Volume 1.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Shellshock 2 Blood Trails.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Vacation Isle Beach Party.html | 2014-10-12 18:16 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Realms of Ancient War.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Gotham City Impostors.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Realms of Ancient War.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Gotham City Impostors.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Jumper Griffin's Story.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Crysis 2 Limited Edition.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Super Metroid.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_F.E.A.R. Extraction Point.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Wonderbook Book of Spells.html | 2014-10-12 18:25 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Section 8 Prejudice.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Atelier Rorona The Alchemist of Arland (Limited Edition).html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Pure Futbol.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mega Man 9.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Section 8 Prejudice.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dark.html | 2014-10-12 18:02 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tiger Woods PGA Tour 11.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Guardians of Middle-Earth.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Harry Potter for Kinect.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Yoostar 2 In the Movies.html | 2014-10-12 18:25 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Forsaken World.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_After Burner Climax.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NCAA Football 11.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Beatles Rock Band.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Schlag den Raab Das 3. Spiel.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Phineas and Ferb Quest for Cool Stuff.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dragon Ball Raging Blast 2.html | 2014-10-12 18:03 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Just Dance Kids 2.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Animal Planet Vet Life.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_FIFA 10.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_DanceMasters.html | 2014-10-12 18:02 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Heavy Fire Afghanistan.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_A Kingdom for Keflings.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Lost Planet Extreme Condition Colonies Edition.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Cabela's Big Game Hunter Hunting Party.html | 2014-10-12 18:00 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Elder Scrolls IV Oblivion - Game of the Year Edition.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cruise Ship Vacation Games.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Nail'd.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dance Paradise.html | 2014-10-12 18:02 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_MX vs. ATV Alive.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Bee Movie Game.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Malicious.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Monster Truck Mayhem.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NBA 09 The Inside.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Schlag den Raab Das 3. Spiel.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Marines Modern Urban Combat.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Xbox Live Arcade Game Pack.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Banjo-Tooie.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Hooked Again Real Motion Fishing.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Red Johnson's Chronicles - One Against All.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Red Johnson's Chronicles - One Against All.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Soulcalibur Lost Swords.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NeverDead.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Young Justice Legacy.html | 2014-10-12 18:25 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The History Channel Civil War Secret Missions.html | 2014-10-12 18:09 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dungeon Siege III.html | 2014-10-12 18:03 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_MLB 07 The Show.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sonic Adventure.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Child of Eden.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sonic Adventure.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ratchet & Clank Full Frontal Assault.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NBA Street Homecourt.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Bionic Commando (2009).html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_LostWinds.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Of Orcs and Men.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Topatoi.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Metro Last Light.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Racquet Sports.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Samurai Warriors 3.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Zumba Fitness Rush.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Shoot Many Robots.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Nobunaga no Yabou Tendou.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Def Jam Rapstar.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Splosion Man.html | 2014-10-12 18:09 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Shoot Many Robots.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Nobunaga no Yabou Tendou.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Def Jam Rapstar.html | 2014-10-12 18:02 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Order Up!.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_North American Hunting Extravaganza 2.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Shiren the Wanderer.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dancing Stage Hottest Party.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Operations Flahspoint Dragon Rising.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_EA Sports Active 2.0.html | 2014-10-12 18:03 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Tenchu Shadow Assassins.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Raiden Fighters Aces.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tomb Raider Survival Collector's Edition.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Pro Yakyuu Spirits 2012.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Counter Strike Global Offensive.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Witch and the Hundred Knight.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Happy Wars.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sound Shapes.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Let's Dance with Mel B.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dynasty Warriors Strikeforce 2 HD Edition.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_MySims Agents.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Def Jam Rapstar.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tomb Raider Survival Collector's Edition.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Twister Mania.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Batman Arkham City Game of the Year Edition.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Zone of the Enders HD Collection.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Resistance Collection.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_WRC 2 FIA World Rally Championshipionship.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Build-A-Bear Workshop Friendship Valley.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Front Mission Evolved.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Worms Revolution.html | 2014-10-12 18:25 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Pro Yakyuu Spirits 2010.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NHL 13.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Worms Revolution.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NHL 13.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dance Central 2.html | 2014-10-12 18:01 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Red Dead Redemption Game of the Year Edition.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Heathcliff The Fast and the Furriest.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Monopoly Collection.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Risen 2 Dark Waters.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Namco Museum Megamix.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Invincible Tiger The Legend of Han Tao.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_FIFA Street 3.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Invincible Tiger The Legend of Han Tao.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_FIFA Street 3.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Petz Sports Dog Playground.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tekken Tag Tournament 2.html | 2014-10-12 18:09 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NHL 10.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dirt Showdown.html | 2014-10-12 18:03 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Pro Yakyuu Spirits 2011.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Jerry Rice & Nitus' Dog Football.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Groovin' Blocks.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_MLB 2K13.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tiger Woods PGA Tour 13 Masters Collector's Edition.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Armored Core 5.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_RISK Factions.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_RISK Factions.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Yu-Gi-Oh! 5D's Duel Transer.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Just Dance 3.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Killer is Dead.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Super Monkey Ball Step & Roll.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dance Dance Revolution Hottest Party 2.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Killer is Dead.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_White Knight Chronicles International Edition.html | 2014-10-12 18:25 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Groovin' Blocks.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Infinite Undiscovery.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Tom Clancy's Ghost Recon.html | 2014-10-12 18:16 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Monopoly Streets.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dance Dance Revolution Hottest Party 5.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rocket Knight.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Wipeout 2.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ennichi No Tatsujin.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Shin Kamaitachi no Yoru 11 Hitome no Suspect.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Resident Evil The Umbrella Chronicles.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_FaceBreaker.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Resident Evil The Darkside Chronicles.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Knytt Underground.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Gatling Gears.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rocket Knight.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Gatling Gears.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Costume Quest.html | 2014-10-12 18:01 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NASCAR 09.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NASCAR 08.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NASCAR 08.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rockstar Games Collection Edition 1.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Pokémon Battle Revolution.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rockstar Games Collection Edition 1.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NBA Live 10.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Chicken Blaster.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Hexic HD.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_UEFA Champions League 2006-2007.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Divekick.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cook-Off Party.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Deadly Premonition The Director's Cut.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Attack of the Movies 3D.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_RUSE.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rock of Ages.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Renegade Ops.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Renegade Ops.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tron Evolution.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sonic's Ultimate Genesis Collection.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rock of Ages.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Phineas and Ferb Across the 2nd Dimension.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Critter Crunch.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Top Shot Arcade.html | 2014-10-12 18:16 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Eat Lead The Return of Matt Hazard.html | 2014-10-12 18:03 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Let's Dance.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Eat Lead The Return of Matt Hazard.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Hello Kitty Seasons.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NCAA Football 13.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Warriors Orochi 3.html | 2014-10-12 18:25 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_MLB 08 The Show.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Megamind Ultimate Showdown.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Blood Drive.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Warhawk (Headset Bundle).html | 2014-10-12 18:25 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Phineas and Ferb Across the 2nd Dimension.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Borderlands 2 Add-On Content Pack.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Matt Hazard Blood Bath and Beyond.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Nier.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Matt Hazard Blood Bath and Beyond.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Assault Heroes.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_GripShift.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Nat Geo Challenge! Wild Life.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Iron Brigade.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Assassin's Creed Double Pack.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Happy Hammerin'.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Smash Cars.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NHL 2K8.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_428 Fuusa Sareta Shibuya de.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ratchet & Clank Tools of Destruction and Ratchet & Clank A Crack in Time.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Battle Princess of Arcadias.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_GripShift.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Far Cry 4.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Power Gig Rise of the SixString.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Lone Survivor The Director's Cut.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Lead and Gold Gangs of the Wild West.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Reload.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Warriors Orochi 3.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Skullgirls.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Madden NFL 12.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Scary Girl.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Scary Girl.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_San Goku Shi 12.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hakuoki Stories of the Shinsengumi.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Resident Evil Code Veronica X HD.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Resident Evil Code Veronica X HD.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Resident Evil 6 Archives.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Puzzle Agent.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Inversion.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Hysteria Hospital Emergency Ward.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ninja Gaiden 3.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_MLB 2K13.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Marble Saga Kororinpa.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Legendary.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Blood Bowl.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Monster Madness Battle for Suburbia.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Le Testament de Sherlock Holmes.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Hard Corps Uprising.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Banjo-Kazooie.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Section 8.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Power Gig Rise of the SixString.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Nurarihyon no Mago Hyakki Ryouran Taisen.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Jikkyou Powerful Pro Yakyuu 2011 Ketteiban.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Nurarihyon no Mago Hyakki Ryouran Taisen.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dance on Broadway.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Virtua Tennis 4.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Supreme Commander.html | 2014-10-12 18:09 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rugby League Live.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Defiance.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rugby League Live.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Defiance.html | 2014-10-12 18:02 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Luftrausers.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Interpol The Trail of Dr. Chaos.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Free Realms.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Hasbro Family Game Night Fun Pack.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Deadly Premonition.html | 2014-10-12 18:02 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Plants vs Zombies.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Gottlieb Pinball Classics.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Joe Danger Special Edition.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_X-Blades.html | 2014-10-12 18:25 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_UFC Undisputed 3.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rotastic.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rotastic.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Wheelman.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SkyDrift.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_SkyDrift.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Castlevania Harmony of Despair.html | 2014-10-12 18:00 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Lord of the Rings Conquest.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_AFL.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NBA 07.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Akiba's Trip Undead & Undressed.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Geometry Wars Retro Evolved 2.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Hasbro Family Game Night Fun Pack.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Wonder Boy in Monster Land.html | 2014-10-12 18:25 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ratatouille.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Joe Danger.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Backbreaker.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Backbreaker.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Snoopy Flying Ace.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mafia II Director's Cut.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Mafia II Director's Cut.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rocketmen It Came from Uranus.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rocketmen It Came from Uranus.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dark Messiah Might and Magic Elements.html | 2014-10-12 18:02 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Cabela's Dangerous Hunts 2009.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_State of Decay.html | 2014-10-12 18:09 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_EA Sports MMA.html | 2014-10-12 18:03 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Majin and the Forsaken Kingdom.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Flock!.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Puzzle Kingdoms.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Flock!.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rock Band 3.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SBK Generations.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Okami HD.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_SBK Generations.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Turok.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cars Toon Mater's Tall Tales.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Divinity II Ego Draconis.html | 2014-10-12 18:03 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Prototype 2.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Black College Football The Xperience.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Shutsugeki!! Otometachi no Senjou 2 Yuukoku o Kakeru Koujo no Tsubasa.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mushroom Wars.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dragon's Lair Trilogy.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Big Time Rush Dance Party.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rockstar Table Tennis.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Warriors Orochi.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Walk It Out!.html | 2014-10-12 18:16 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_SpongeBob's Truth or Square.html | 2014-10-12 18:09 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_R.U.S.E..html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Super Rub A Dub.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Space Invaders Infinity Gene.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Space Invaders Infinity Gene.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dead Rising 2 Case Zero.html | 2014-10-12 18:02 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Shatter.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dead Rising 2 Case West.html | 2014-10-12 18:02 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Family Party Fitness Fun.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_101-in-1 Sports Party Megamix.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rochard.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dawn of Discovery.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Resident Evil Raccoon City Special Edition.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Man Vs. Wild.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Far Cry 2.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Stormrise.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Nat Geo Challenge! Wild Life.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_All Star Cheer Squad 2.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Stormrise.html | 2014-10-12 18:09 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Bodycount.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Scott Pilgrim vs. the World.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_L.A. Noire The Complete Edition.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Scott Pilgrim vs. the World.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_JoJo's Bizarre Adventure HD Ver..html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_JoJo's Bizarre Adventure HD Ver..html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Army of Two The Devil's Cartel.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tekken Hybrid.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Buzz! Quiz TV.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Deadliest Warrior Legends.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Deadliest Warrior Legends.html | 2014-10-12 18:02 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Soul Calibur IV & Tekken 6.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Final Fight Double Impact.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Buzz! Junior Jungle Party.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Soul Calibur IV & Tekken 6.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Midnight Club Los Angeles.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Final Fight Double Impact.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Red Faction Battlegrounds.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Alex Kidd in Miracle World.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Red Faction Battlegrounds.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Galaga Legions DX.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Midnight Club Los Angeles.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Fast Food Panic.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Skate 3.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hannah Montana The Movie.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rygar The Battle of Argus.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Kingdom Under Fire Circle of Doom.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Hannah Montana The Movie.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Castlevania Harmony of Despair.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dash of Destruction.html | 2014-10-12 18:02 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tales of Zestiria.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Spore Hero.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Maw.html | 2014-10-12 18:09 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Scooby-Doo! and the Spooky Swamp.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Bionic Commando Rearmed 2.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tropico 3.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Blackwater.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Bionic Commando Rearmed 2.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Noby Noby Boy.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Trine.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rush'N Attack Ex-Patriot.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Bellator MMA Onslaught.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_TV Superstars.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Grid 2.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dead or Alive 5 Ultimate.html | 2014-10-12 18:02 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Deer Drive.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Halo 3 Limited Edition.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Grid 2.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Bellator MMA Onslaught.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Simpsons Arcade Game.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_2nd Super Robot Wars Original Generation.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Simpsons Arcade Game.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Wipeout HD.html | 2014-10-12 18:25 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Guitar Hero Warriors of Rock.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NBA 2K10 Draft Combine.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NBA 2K10 Draft Combine.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NBA Ballers Chosen One.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Skylanders Swap Force.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Petz Horse Club.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Auqa Panic!.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Backyard Sports Football Rookie Rush.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Penguins of Madagascar Dr. Blowhole Returns – Again!.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sengoku Basara Samurai Heroes.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Motionsports Adrenaline.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Motionsports Adrenaline.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rocketmen Axis of Evil.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Story Hour Fairy Tales.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rocketmen Axis of Evil.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Slotter Chou Mania Antonio Inoki ga Genki ni Suru Pachi-Slot Ki.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Saint.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hamilton's Great Adventure.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Big Catch Bass Fishing 2.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Hellboy The Science of Evil.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_God of War Origins Collection.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dreamcast Collection.html | 2014-10-12 18:03 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sly 2 Band of Thieves.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Alan Wake The Writer.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Jikkyou Powerful Pro Yakyuu 2010.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Last Airbender.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dynasty Warriors 5 Empires.html | 2014-10-12 18:03 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Doritos Crash Course 2.html | 2014-10-12 18:03 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mortal Kombat HD Arcade Kollection.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Jikkyou Powerful Pro Yakyuu 2011.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Time and Eternity.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sneak King.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ms. Splosion Man.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fuel.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Soldner-X Himmelssturmer.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Yoostar on MTV.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Undertow.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Stacking.html | 2014-10-12 18:09 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Prey Limited Collector's Edition.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Shadow of the Colossus.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hatsune Miku Project DIVA F.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Death Track Resurrection.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Baja Edge of Control.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sacred Citadel.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_FlatOut Ultimate Carnage.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_FIFA 09.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_FIFA 08.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Scene It Movie Night.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Beyond Good & Evil HD.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Hip Hop Dance Experience.html | 2014-10-12 18:09 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Scene It Movie Night.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Shadows of the Damned.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Hardy Boys The Hidden Theft.html | 2014-10-12 18:16 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Disney Guilty Party.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Price Is Right Decades.html | 2014-10-12 18:09 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dead Nation.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Penguins of Madagascar Dr. Blowhole Returns - Again!.html | 2014-10-12 18:09 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Journey Collector's Edition.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Call of Duty Classic.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Hip Hop Dance Experience.html | 2014-10-12 18:16 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rugby World Cup 2011.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ken to Mahou to Gakuen Mono. 3.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_DiRT 2.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rugby World Cup 2011.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Giana Sisters Twisted Dreams.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Naughty Bear Gold Edition.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar Morangos com Acucar.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fight Night Round 4.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Gremlins Gizmo.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_James Bond 007 Quantum of Solace -- Collector's Edition.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Turning Point Fall Of Liberty.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Mass Effect Trilogy.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Darkstalkers Resurrection.html | 2014-10-12 18:02 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hyperdimension Neptunia.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rampage World Tour.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dead Space Ignition.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dead Space Ignition.html | 2014-10-12 18:02 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Cabela's Big Game Hunter.html | 2014-10-12 18:00 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Peter Jackson's King Kong.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Fight Night Round 4.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Clash of the Titans.html | 2014-10-12 18:01 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_FIFA Soccer 12.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Wild Earth African Safari.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sonic the Fighters.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_One Piece Unlimited Adventure.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sonic the Fighters.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Disney Sing It Party Hits.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Skate.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Railfan Taiwan High Speed Rail.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Resident Evil 4 HD.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cranium Kabookii.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Hot Wheels World's Best Driver.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_XCOM Enemy Within.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Stealth Inc.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ultimate Board Game Collection.html | 2014-10-12 18:16 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_M&M's Adventure.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NFL Head Coach 09.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Madden NFL Arcade.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Madden NFL Arcade.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Game Party.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sorcery.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hail to the Chimp.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rise of Nightmares.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Thomas & Friends Hero of the Rails.html | 2014-10-12 18:16 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Magna Carta 2.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar Apres-Ski Party 2.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Mahjong ★ Dream C Club.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Adventure Time Explore The Dungeon Because I Dont Know.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mahjong ★ Dream C Club.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hydrophobia Prophecy.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_WarTech Senko No Ronde.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_BioShock 2 Special Edition.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_John Daly's Prostroke Golf.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Trine 2.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Slam Bolt Scrappers.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dance on Broadway.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_My Word Coach.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar Latino.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rinne no Lagrange Kamogawa Days Game & OVA Hybrid Disc.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Monster World IV.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Singstar Made in Germany.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Way of the Samurai 3.html | 2014-10-12 18:25 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Get Up and Dance.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Eternal Sonata.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Adidas miCoach.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Adidas miCoach.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Fishing Master World Tour.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar Queen.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Jumpstart Pet Resuce.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Cabels's Trophy Bucks.html | 2014-10-12 18:00 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_AirMech Arena.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar Mallorca Party.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Burn Zombie Burn!.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Payday The Heist.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Get Up and Dance.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Kengo Legend of the 9.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rugby League Live 2.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rugby League Live 2.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sideway New York.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Grand Slam Tennis 2.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Clan of Champions.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Mr. Bean's Wacky World.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NBA Unrivaled.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NBA Unrivaled.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Mahjong Tsuushin Taikyoku Kinoudzuke.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_EA Sports MMA.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Tak and the Guardians of Gross.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_PokePark 2 Wonders Beyond.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar ABBA.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ratchet & Clank.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Lips Number One Hits.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Uncharted 2 Among Thieves Fortune Hunter Edition.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tales of Monkey Island.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Blade & Soul.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Doritos Crash Course.html | 2014-10-12 18:03 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar The Wiggles.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_MotoGP 09 10.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dynasty Warriors 8.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_MotoGP 09 10.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Nickelodeon Dance 2.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rainbow Moon.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Legends Warriors of Troy.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Red Baron Arcade.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_AquaPazza AquaPlus Dream Match.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Lips Party Classics.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Grease Dance.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar Fussballhits.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar Chartbreaker.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sengoku Basara 3 Utage.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Le Tour de France.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Machi-ing Maker 4.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dust An Elysian Tail.html | 2014-10-12 18:03 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Nickelodeon Dance 2.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rapala We Fish.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Le Tour de France.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_EA Sports Active 2.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Pure Futbol.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NCAA Basketball 09 March Madness Edition.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Worms Collection.html | 2014-10-12 18:25 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Swords & Soldiers.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_My Fitness Coach Club.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Spare Parts.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rayman 3 HD.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dragon Age Origins - Collector's Edition.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dance Magic.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Spare Parts.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rayman 3 HD.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_RayStorm HD.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dance Magic.html | 2014-10-12 18:02 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Imabikisō.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Worms Collection.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Sengoku Basara 3 Utage.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_AC DC Live Rock Band.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Wicked Monsters BLAST!.html | 2014-10-12 18:16 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Nickelodeon Dance.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar Chart Hits.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sangoku Hime Senkou no Taika - Akatsuki no Haryuu.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_MLB 09 The Show.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_My Fitness Coach Club.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_You're In The Movies.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Last Guardian.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ibb and Obb.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Real Steel.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Real Steel.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar Studio 100.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Gundam Breaker.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Toy Story Mania!.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Astro Tripper.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Monday Night Combat.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Fat Princess.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Hotel for Dogs.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_A World of Keflings.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Minute to Win It.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Shooting Love 10-Shuunen XIIZeal & DeltaZeal.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Resident Evil Chronicles HD Collection.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Machi-ing Maker 4.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Fit in Six.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NBA 2K6.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Atelier Rorona The Alchemist of Arland.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar Take That.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Obut Pétanque 2.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_U-Sing.html | 2014-10-12 18:16 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Street Fighter X Tekken Special Edition.html | 2014-10-12 18:09 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Obut Pétanque 2.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Rocksmith 2014.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NFL Tour.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Motorstorm rc.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_MicroBot.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NFL Tour.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_MicroBot.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mindjack.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hiiro no Kakera Aizouban Akane Iro no Tsuioku.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fracture.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Fit in Six.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Def Jam Icon.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mobile Suit Gundam Battlefield Record U.C. 0081.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Texas Hold 'Em.html | 2014-10-12 18:09 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Bigfoot Collision Course.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Forza Motorsport 4 Essentials Edition.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sekai Saikyou Ginsei Shogi Fuuum Ryouko Raiden.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_XBLA Triple Pack.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_uDraw Marvel Super Hero Squad Comic Combat.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Deadstorm Pirates.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Crimson Alliance.html | 2014-10-12 18:01 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Cake Mania In The Mix.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Outland.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Outland.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Dog Island.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Naughty Bear.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Darkest of Days.html | 2014-10-12 18:02 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Naughty Bear.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ar Tonelico Qoga Knell of Ar Ciel.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Grease Dance.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_InFamous Festival of Blood.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Amy.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar Motown.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar Mecano.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Gray Matter.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Blood Drive.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Atelier Meruru The Apprentice of Arland.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_RayStorm HD.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_LittleBigPlanet 2 Special Edition.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Battle Los Angeles.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Wonder Boy in Monster World.html | 2014-10-12 18:25 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dragon Quest X.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_My Body Coach 2.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tornado Outbreak.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Super Stardust HD.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Man Vs. Wild.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Gears of War 3 Limited Edition.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Hasbro Family Game Night 1 & 2 Bundle.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ninja Gaiden Sigma 2.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_My Body Coach 2.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar Vasco.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Wreckateer.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Saw.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sekai Saikyou Ginsei Igo Hybrid Monte Carlo.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Ben 10 Ultimate Alien Cosmic Destruction.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rag Doll Kung Fu Fists of Plastic.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Super Mario 64.html | 2014-10-12 18:15 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Leisure Suit Larry Box Office Bust.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fuse.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_EyePet.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Backyard Sports Sandlot Sluggers.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Mystery Case Files The Malgrave Incident.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Disgaea Dimension 2 A Brighter Darkness.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mugen Souls Z.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_MLB 10 The Show.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Geon Cube.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Formula One Championship Edition.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ratchet & Clank 3 Up Your Arsenal.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Wipeout 2.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ninja Blade.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Acceleration of Suguri X Edition.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_King of Fighters Collection The Orochi Saga.html | 2014-10-12 18:13 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Tom Clancy's Splinter Cell HD Trilogy.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Imabikisō.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Cuboid.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Assassin's Creed Ezio Trilogy.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Elder Scrolls IV Shivering Isles.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Alvin and the Chipmunks The Squeakquel.html | 2014-10-12 18:11 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Worm's Crazy Golf.html | 2014-10-12 18:25 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hyperdimension Neptunia Victory.html | 2014-10-12 18:20 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Rock Blast.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Under Defeat HD Deluxe Edition.html | 2014-10-12 18:24 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Risen 2 Dark Waters Special Edition.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Kinect Joy Ride.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dead Rising 2 - Zombrex Edition.html | 2014-10-12 18:02 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_NHL 14.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Damage Inc. Pacific Squadron WWII.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Pirates Hunt for Blackbeard's Booty.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Jillian Michaels' Fitness Adventure.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Monster Madness Grave Danger.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mobile Suit Gundam Crossfire.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Disney's Chicken Little Ace in Action.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The Biggest Loser Ultimate Workout.html | 2014-10-12 18:09 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sanctum 2.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_New Play Control! Mario Power Tennis.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_GTI Club + Rally Cote D'Azur.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Marvel Ultimate Alliance Gold.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Xbox Live Arcade Unplugged, Vol. 1.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Soldner-X 2 Final Prototype.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Best of PlayStation Network Vol. 1.html | 2014-10-12 18:17 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Pinball FX 2 Marvel Pinball.html | 2014-10-12 18:07 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ryoufuu no Melt Days in the Sanctuary.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_EA Sports Active More Workouts.html | 2014-10-12 18:12 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Sesame Street Once Upon a Monster.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_My Horse & Me Riding for Gold.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_One Piece Pirate Warriors 2.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Island of Dr. Frankenstein.html | 2014-10-12 18:16 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fatal Inertia.html | 2014-10-12 18:04 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Fuse.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Heavy Fire Shattered Spear.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sackboy's Prehistoric Moves.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_F1 2013.html | 2014-10-12 18:19 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dance Dance Revolution Universe 2.html | 2014-10-12 18:01 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mobile Suit Gundam Battle Operation.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_WWE 2K14.html | 2014-10-12 18:10 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Deus Ex.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_No More Heroes Heroes' Paradise.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_PokePark.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ryu ga Gotoku 5 Yume, Kanaeshi Mono.html | 2014-10-12 18:23 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Medieval Moves Deadmund's Quest.html | 2014-10-12 18:21 | 40K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Petz Sports.html | 2014-10-12 18:14 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_BioShock Infinite Burial at Sea.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Dark Souls Collector's Edition.html | 2014-10-12 18:18 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Amy.html | 2014-10-12 17:59 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_MorphX.html | 2014-10-12 18:06 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Lips.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Scene It Box Office Smash.html | 2014-10-12 18:08 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_One Piece Pirate Warriors.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ratchet & Clank Into the Nexus.html | 2014-10-12 18:22 | 40K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Mars Rover Landing.html | 2014-10-12 18:05 | 40K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_PixelJunk Racers 2nd Lap.html | 2014-10-12 18:22 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Muchi Muchi Pork! & Pink Sweets.html | 2014-10-12 18:06 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Naval Assault The Killing Tide.html | 2014-10-12 18:06 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Saints Row Double Pack.html | 2014-10-12 18:08 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Amped 3.html | 2014-10-12 17:59 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Super Karts.html | 2014-10-12 18:15 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Michael Phelps Push the Limit.html | 2014-10-12 18:06 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Wonderbook Diggs Nightcrawler.html | 2014-10-12 18:25 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Red Johnson's Chronicles.html | 2014-10-12 18:22 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dragon Blade Wrath Of Fire.html | 2014-10-12 18:12 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_F.E.A.R. Perseus Mandate.html | 2014-10-12 18:04 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Raiden IV.html | 2014-10-12 18:07 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Cabela's Big Game Hunter 2010.html | 2014-10-12 18:00 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Attouteki Yuugi Mugen Souls Z.html | 2014-10-12 18:17 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Vampire Rain Altered Species.html | 2014-10-12 18:24 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ilomilo.html | 2014-10-12 18:05 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Gran Turismo HD Concept.html | 2014-10-12 18:19 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Days of Thunder Arcade.html | 2014-10-12 18:02 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_PlayStation Move Heroes.html | 2014-10-12 18:22 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Namco Museum Virtual Arcade.html | 2014-10-12 18:06 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Deathsmiles Limited Edition.html | 2014-10-12 18:02 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Steel Battalion Heavy Armor.html | 2014-10-12 18:09 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ryu ga Gotoku 1&2 HD Edition.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Brain Challenge Deluxe.html | 2014-10-12 18:18 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Saint Seiya Sanctuary Battle.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_PixelJunk SideScroller.html | 2014-10-12 18:22 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Blue Toad Murder Files.html | 2014-10-12 18:17 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Around the World in 50 Games.html | 2014-10-12 18:11 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_MotionSports Play for Real.html | 2014-10-12 18:06 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Sing It.html | 2014-10-12 18:15 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hyperdimension Neptunia mk2.html | 2014-10-12 18:20 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_High Velocity Bowling.html | 2014-10-12 18:20 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Lips I Love the 80s.html | 2014-10-12 18:05 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Lost in Shadow.html | 2014-10-12 18:13 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Crash Time 4 The Syndicate.html | 2014-10-12 18:18 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Resistance Dual Pack.html | 2014-10-12 18:22 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_White Knight Chronicles II.html | 2014-10-12 18:25 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Enclave Shadows of Twilight.html | 2014-10-12 18:12 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Bullet Soul Infinite Burst.html | 2014-10-12 18:00 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Time Crisis Razing Storm.html | 2014-10-12 18:24 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hamsterball.html | 2014-10-12 18:20 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Gunblade NY & LA Machineguns.html | 2014-10-12 18:13 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Victorious Time to Shine.html | 2014-10-12 18:10 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_PixelJunk Shooter 2.html | 2014-10-12 18:22 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_LocoRoco Cocoreccho.html | 2014-10-12 18:20 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Victorious Taking the Lead.html | 2014-10-12 18:16 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Body and Brain Connection.html | 2014-10-12 17:59 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Let's Tap.html | 2014-10-12 18:13 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Get Fit With Mel B.html | 2014-10-12 18:19 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Just Dance Greatest Hits.html | 2014-10-12 18:05 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Anarchy Rush Hour.html | 2014-10-12 18:17 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sengoku Basara HD Collection.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sengoku Basara 3 Double Pack.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The Croods Prehistoric Party!.html | 2014-10-12 18:15 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_PixelJunk Monsters.html | 2014-10-12 18:22 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_LEGO Batman Pure.html | 2014-10-12 18:05 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Karaoke Revolution.html | 2014-10-12 18:20 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Heroes Over Europe.html | 2014-10-12 18:20 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Magic Orbz.html | 2014-10-12 18:20 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Buzz! Quiz World.html | 2014-10-12 18:18 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Warhammer Battle March.html | 2014-10-12 18:10 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Naruto The Broken Bond.html | 2014-10-12 18:06 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Kinect Sports Season 2.html | 2014-10-12 18:05 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Lumines Supernova.html | 2014-10-12 18:20 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Playmobil Circus.html | 2014-10-12 18:14 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Death Jr. Root of Evil.html | 2014-10-12 18:12 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Qubed.html | 2014-10-12 18:07 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_PixelJunk Racers.html | 2014-10-12 18:22 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_DoDonPachi Saidaioujou.html | 2014-10-12 18:03 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Kinect Star Wars.html | 2014-10-12 18:05 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Just Dance Disney Party.html | 2014-10-12 18:13 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar Digital.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Carnival Games Mini Golf.html | 2014-10-12 18:11 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Bakugen Battle Brawlers.html | 2014-10-12 18:11 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Family Feud 2010 Edition.html | 2014-10-12 18:12 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Fight Lights Out.html | 2014-10-12 18:24 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Mushihime-sama HD.html | 2014-10-12 18:06 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar Back to the 80s.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hyperballoid HD.html | 2014-10-12 18:20 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Great Party Games.html | 2014-10-12 18:12 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar Vol. 2.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Everybody Dance.html | 2014-10-12 18:19 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Planet Minigolf.html | 2014-10-12 18:22 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_The $1,000,000 Pyramid.html | 2014-10-12 18:15 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Overlord Dark Legend.html | 2014-10-12 18:14 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Comic Jumper.html | 2014-10-12 18:01 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Tony Hawk Shred Stand-Alone Software.html | 2014-10-12 18:10 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Marvel Pinball.html | 2014-10-12 18:21 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_F.E.A.R. Files.html | 2014-10-12 18:04 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Mushihimesama Futari.html | 2014-10-12 18:06 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar Dance.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Armored Core V.html | 2014-10-12 18:17 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_InFamous Collection.html | 2014-10-12 18:20 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_PixelJunk 4am.html | 2014-10-12 18:22 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Papo & Yo.html | 2014-10-12 18:22 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Echochrome ii.html | 2014-10-12 18:19 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sengoku Musou 3 Empires.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Wipeout in the Zone.html | 2014-10-12 18:10 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Wacky World of Sports.html | 2014-10-12 18:16 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Kung Fu Rider.html | 2014-10-12 18:20 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_After Hours Athletes.html | 2014-10-12 18:17 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Spelunker HD.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar Polskie Hity.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Operation Darkness.html | 2014-10-12 18:07 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Kung-Fu Live.html | 2014-10-12 18:20 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Pinballistik.html | 2014-10-12 18:22 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Fishing Resort.html | 2014-10-12 18:12 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Smash 'N' Survive.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Counter-Strike GO.html | 2014-10-12 18:01 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ryu ga Gotoku Kenzan!.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dream Dance & Cheer.html | 2014-10-12 18:12 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Comet Crash.html | 2014-10-12 18:18 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_DanceStar Party Hits.html | 2014-10-12 18:18 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Big League Sports.html | 2014-10-12 17:59 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Assault Heroes 2.html | 2014-10-12 17:59 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_PixelJunk 3 in 1 Pack.html | 2014-10-12 18:22 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Killzone HD.html | 2014-10-12 18:20 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Family Feud Decades.html | 2014-10-12 18:12 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Mugen Souls.html | 2014-10-12 18:21 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Savage Moon.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sky Fighter.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Medal of Honor Heroes 2.html | 2014-10-12 18:13 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Jewel Quest Trilogy.html | 2014-10-12 18:13 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Spelunker Collection.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Trinity Universe.html | 2014-10-12 18:24 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Start The Party!.html | 2014-10-12 18:24 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_La Mulana.html | 2014-10-12 18:13 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sports Champions.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Killzone Trilogy.html | 2014-10-12 18:20 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Motion Explosion.html | 2014-10-12 18:06 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar Pop Edition.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Hakuoki Junsouroku.html | 2014-10-12 18:20 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Deep Black.html | 2014-10-12 18:18 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Move Street Cricket.html | 2014-10-12 18:21 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_11 Eyes CrossOver.html | 2014-10-12 17:59 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Snakeball.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Aquatopia.html | 2014-10-12 18:17 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Carnival Island.html | 2014-10-12 18:18 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Carmageddon Reincarnation.html | 2014-10-12 18:18 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Carmageddon Reincarnation.html | 2014-10-12 18:00 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Legasista.html | 2014-10-12 18:20 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_My Fitness Coach.html | 2014-10-12 18:14 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Unfinished Swan.html | 2014-10-12 18:24 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Obut Pétanque.html | 2014-10-12 18:22 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Under Defeat HD.html | 2014-10-12 18:10 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dance Sensation!.html | 2014-10-12 18:12 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Fantastic Pets.html | 2014-10-12 18:04 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Kick-Ass.html | 2014-10-12 18:20 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Mini Golf Resort.html | 2014-10-12 18:13 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_PowerUP Heroes.html | 2014-10-12 18:07 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_DUST 514.html | 2014-10-12 18:19 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Race Pro.html | 2014-10-12 18:07 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Dewy's Adventure.html | 2014-10-12 18:12 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Zoids Assault.html | 2014-10-12 18:10 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Junk Fu.html | 2014-10-12 18:05 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Shin Toudai Shogi.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sengoku Musou 3 Z.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Kinect Sports.html | 2014-10-12 18:05 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Counter Force.html | 2014-10-12 18:12 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_NHL 2K11.html | 2014-10-12 18:14 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ginga Force.html | 2014-10-12 18:04 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar Vol. 3.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar Hits 2.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar Guitar.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_We Ski & Snowboar.html | 2014-10-12 18:16 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Espgaluda 2.html | 2014-10-12 18:04 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Robotics;Notes.html | 2014-10-12 18:22 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Sodium One.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Science papa.html | 2014-10-12 18:15 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_PAIN.html | 2014-10-12 18:22 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_The Shoot.html | 2014-10-12 18:24 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_SingStar Hits.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_AFL Live.html | 2014-10-12 18:17 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Eschatos.html | 2014-10-12 18:04 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Afrika.html | 2014-10-12 18:17 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Shiki-tei.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Truck Racer.html | 2014-10-12 18:16 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Railfan.html | 2014-10-12 18:22 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_LIT.html | 2014-10-12 18:13 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Octomania.html | 2014-10-12 18:14 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_The History Channel Battle for the Pacific.html | 2014-10-12 18:09 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Gummy Bears Magical Medallion.html | 2014-10-12 18:13 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Myth Makers Orbs of Doom.html | 2014-10-12 18:14 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ratchet & Clank Going Commando.html | 2014-10-12 18:22 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Ravensdale.html | 2014-10-12 18:22 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Ravensdale.html | 2014-10-12 18:07 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Spin Jam.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rocksmith - Best Buy exclusive edition with unique Gibson Guitar.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rush'N Attack Ex-Patriot.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Playboys! The Experience!.html | 2014-10-12 18:07 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Playboys! The Experience!.html | 2014-10-12 18:22 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Disney Sing It Party Hits.html | 2014-10-12 18:18 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Shuukan Toro Station.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Spartacus Legends.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Pet Pals Animal Doctor.html | 2014-10-12 18:14 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rocksmith [Includes Bass].html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_NCAA Football 14.html | 2014-10-12 18:06 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Nickelodeon Dance.html | 2014-10-12 18:14 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Rocksmith 2014.html | 2014-10-12 18:23 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_RA.ONE The Game.html | 2014-10-12 18:22 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Neutopia.html | 2014-10-12 18:21 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Battlefield Bad Company 2 Ultimate Edition.html | 2014-10-12 17:59 | 39K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Nicktoons MLB.html | 2014-10-12 18:14 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dance! It's Your Stage.html | 2014-10-12 18:02 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Dishonored The Knife of Dunwall.html | 2014-10-12 18:03 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Morph.html | 2014-10-12 18:06 | 39K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Playstation Plus Membership.html | 2014-10-12 18:22 | 39K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Get Up And Dance HITS!.html | 2014-10-12 18:04 | 38K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Family Feud 2012 Edition.html | 2014-10-12 18:12 | 38K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Top Gun Hard Lock.html | 2014-10-12 18:10 | 38K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_Super Duper Oink.html | 2014-10-12 18:24 | 38K | |
![[TXT]](/icons/text.gif) | Microsoft Xbox 360_Samuri shodown .html | 2014-10-12 18:08 | 38K | |
![[TXT]](/icons/text.gif) | Nintendo Wii_Squeeballs Party.html | 2014-10-12 18:15 | 38K | |
![[TXT]](/icons/text.gif) | Sony Playstation 3_XCOM.html | 2014-10-12 18:25 | 38K | |
|